capsular polysaccharide, streptoccal group B type V
TL;DR: capsular polysaccharide, streptoccal group B type V (CAS 134366-06-6) is a chemical compound with molecular formula C49H82N2O39 and molecular weight 1322.45 g/mol, supplied by Kehong Biological (Henan Kehong Biological Technology Co., Ltd.) with CRO/CDMO custom synthesis services.
(2S,4S,5R,6R)-5-acetamido-2-[(2S,3R,4S,5S,6R)-2-[(2R,3S,4R,5R,6S)-5-acetamido-4-hydroxy-2-(hydroxymethyl)-6-[[(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[(2R,3S,4R,5R,6S)-5-hydroxy-2-(hydroxymethyl)-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-6-[(2R,3S,4R,5R,6R)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxyoxan-3-yl]oxyoxan-2-yl]methoxy]oxan-3-yl]oxy-3,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl]oxy-4-hydroxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid
Also Known As: Gbvscp, GlyTouCan:G21065ZN, Streptococcal polysaccharide V group B, Group B type V strep capsular polysaccharide, G21065ZN
| Molecular Formula | C49H82N2O39 |
|---|---|
| Molecular Weight | 1322.45 g/mol |
| LogP | -16.7828 |
| Topological Polar Surface Area | 660.55 Ų |
| Hydrogen Bond Donors | 25 |
| Hydrogen Bond Acceptors | 38 |
| Rotatable Bonds | 24 |
| Exact Mass | 1322.4495 |
| Heavy Atoms | 90 |
| Complexity | 2288.3853 |
Chemical Identifiers
| CAS Number | 134366-06-6 |
|---|---|
| SMILES | CC(=O)N[C@@H]1[C@H](C[C@@](O[C@H]1[C@@H]([C@@H](CO)O)O)(C(=O)O)O[C@H]2[C@H]([C@H](O[C@H]([C@@H]2O)O[C@@H]3[C@H](O[C@@H]([C@@H]([C@H]3O)NC(=O)C)OC[C@@H]4[C@H]([C@@H]([C@H]([C@H](O4)O[C@H]5[C@H](O[C@H]([C@@H]([C@H]5O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O)O)O[C@@H]7[C@H](O[C@H]([C@@H]([C@H]7O)O)O)CO)CO)O)O)O)CO)CO)O)O |
Product Overview
capsular polysaccharide, streptoccal group B type V (CAS 134366-06-6), with molecular formula C49H82N2O39 and molecular weight 1322.45 g/mol. IUPAC: (2S,4S,5R,6R)-5-acetamido-2-[(2S,3R,4S,5S,6R)-2-[(2R,3S,4R,5R,6S)-5-acetamido-4-hydroxy-2-(hydroxymethyl)-6-[[(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[(2R,3S,4R,5R,6S)-5-hydroxy-2-(hydroxymethyl)-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-6-[(2R,3S,4R,5R,6R)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxyoxan-3-yl]oxyoxan-2-yl]methoxy]oxan-3-yl]oxy-3,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl]oxy-4-hydroxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid.
Chemical Property Profile of capsular polysaccharide, streptoccal group B type V
Property Insights of capsular polysaccharide, streptoccal group B type V
The XLogP value of -16.7828 indicates that capsular polysaccharide, streptoccal group B type V is hydrophilic (water-soluble), making it suitable for aqueous formulations and biological assay applications. The TPSA of 660.55 Ų indicates high polarity, suggesting capsular polysaccharide, streptoccal group B type V may have limited membrane permeability but good aqueous solubility. Following Lipinski's Rule of Five, capsular polysaccharide, streptoccal group B type V has 25 hydrogen bond donor(s) and 38 hydrogen bond acceptor(s), which may warrant consideration for formulation optimization.
Frequently Asked Questions
Frequently Asked Questions
What is the CAS number of capsular polysaccharide, streptoccal group B type V?
The CAS number of capsular polysaccharide, streptoccal group B type V is 134366-06-6.
What is the molecular formula of capsular polysaccharide, streptoccal group B type V?
The molecular formula of capsular polysaccharide, streptoccal group B type V is C49H82N2O39.
What is the molecular weight of capsular polysaccharide, streptoccal group B type V?
The molecular weight of capsular polysaccharide, streptoccal group B type V is 1322.45 g/mol.
Where can I buy capsular polysaccharide, streptoccal group B type V?
You can request a quote for capsular polysaccharide, streptoccal group B type V directly from KEHONG BIO. Contact us or email info@kehongbio.com for pricing and availability.
Does KEHONG BIO offer custom synthesis for capsular polysaccharide, streptoccal group B type V?
Yes, KEHONG BIO provides custom synthesis services for capsular polysaccharide, streptoccal group B type V and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.