Antibiotic B 14437 (base)
TL;DR: Antibiotic B 14437 (base) (CAS 18417-89-5) is a chemical compound with molecular formula C12H15N5O5 and molecular weight 309.11 g/mol, supplied by Kehong Biological (Henan Kehong Biological Technology Co., Ltd.) with CRO/CDMO custom synthesis services.
4-amino-7-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrrolo[2,3-d]pyrimidine-5-carboxamide
Also Known As: sangivamycin, Sauzivamycin, Ara-sangivamycin, Antibiotic B 14437 (base), Antibiotic B-14437
| Molecular Formula | C12H15N5O5 |
|---|---|
| Molecular Weight | 309.11 g/mol |
| LogP | -2.5 |
| Topological Polar Surface Area | 170.0 Ų |
| Hydrogen Bond Donors | 5 |
| Hydrogen Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Exact Mass | 309.10733 |
| Heavy Atoms | 22 |
| Complexity | 440.0 |
Chemical Identifiers
| CAS Number | 18417-89-5 |
|---|---|
| SMILES | C1=C(C2=C(N=CN=C2N1C3C(C(C(O3)CO)O)O)N)C(=O)N |
| InChIKey | OBZJZDHRXBKKTJ-UHFFFAOYSA-N |
Product Overview
Antibiotic B 14437 (base) (CAS 18417-89-5), with molecular formula C12H15N5O5 and molecular weight 309.11 g/mol. IUPAC: 4-amino-7-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrrolo[2,3-d]pyrimidine-5-carboxamide.
Chemical Property Profile of Antibiotic B 14437 (base)
Property Insights of Antibiotic B 14437 (base)
The XLogP value of -2.5 indicates that Antibiotic B 14437 (base) is hydrophilic (water-soluble), making it suitable for aqueous formulations and biological assay applications. The TPSA of 170.0 Ų indicates high polarity, suggesting Antibiotic B 14437 (base) may have limited membrane permeability but good aqueous solubility. Following Lipinski's Rule of Five, Antibiotic B 14437 (base) has 5 hydrogen bond donor(s) and 8 hydrogen bond acceptor(s), all within the drug-like range, suggesting favorable oral bioavailability potential.
Frequently Asked Questions
Frequently Asked Questions
What is the CAS number of Antibiotic B 14437 (base)?
The CAS number of Antibiotic B 14437 (base) is 18417-89-5.
What is the molecular formula of Antibiotic B 14437 (base)?
The molecular formula of Antibiotic B 14437 (base) is C12H15N5O5.
What is the molecular weight of Antibiotic B 14437 (base)?
The molecular weight of Antibiotic B 14437 (base) is 309.11 g/mol.
Where can I buy Antibiotic B 14437 (base)?
You can request a quote for Antibiotic B 14437 (base) directly from KEHONG BIO. Contact us or email info@kehongbio.com for pricing and availability.
Does KEHONG BIO offer custom synthesis for Antibiotic B 14437 (base)?
Yes, KEHONG BIO provides custom synthesis services for Antibiotic B 14437 (base) and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.