B 193
TL;DR: B 193 (CAS 124824-14-2) is a chemical compound with molecular formula C25H32Cl2N4O and molecular weight 474.20 g/mol, supplied by Kehong Biological (Henan Kehong Biological Technology Co., Ltd.) with CRO/CDMO custom synthesis services.
9-methyl-2-[3-(4-phenylpiperazin-1-yl)propyl]-3,4-dihydropyrido[3,4-b]indol-1-one;dihydrochloride
Also Known As: B 193, B-193, 1H-Pyrido(3,4-b)indol-1-one, 2,3,4,9-tetrahydro-9-methyl-2-(3-(4-phenyl-1-piperazinyl)propyl)-, dihydrochloride, 9-Methyl-2-(3-(4-phenyl-1-piperazinylpropyl))-1,2,3,4-tetrahydro-beta-carbolin-1-one 2HCl, 9-methyl-2-[3-(4-phenylpiperazin-1-yl)propyl]-3,4-dihydropyrido[3,4-b]indol-1-one;dihydrochloride
| Molecular Formula | C25H32Cl2N4O |
|---|---|
| Molecular Weight | 474.20 g/mol |
| LogP | 4.2325 |
| Topological Polar Surface Area | 31.7 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Exact Mass | 474.1953 |
| Heavy Atoms | 32 |
| Complexity | 584.0 |
Chemical Identifiers
| CAS Number | 124824-14-2 |
|---|---|
| SMILES | CN1C2=CC=CC=C2C3=C1C(=O)N(CC3)CCCN4CCN(CC4)C5=CC=CC=C5.Cl.Cl |
| InChIKey | BSXVJHKCRCHNJD-UHFFFAOYSA-N |
Product Overview
B 193 (CAS 124824-14-2), with molecular formula C25H32Cl2N4O and molecular weight 474.20 g/mol. IUPAC: 9-methyl-2-[3-(4-phenylpiperazin-1-yl)propyl]-3,4-dihydropyrido[3,4-b]indol-1-one;dihydrochloride.
Chemical Property Profile of B 193
Property Insights of B 193
The XLogP value of 4.2325 indicates that B 193 is lipophilic (fat-soluble), which may influence its absorption, distribution, and formulation strategy. With a topological polar surface area (TPSA) of 31.7 Ų, B 193 exhibits relatively low polarity, potentially indicating favorable cell membrane permeability. Following Lipinski's Rule of Five, B 193 has 2 hydrogen bond donor(s) and 3 hydrogen bond acceptor(s), all within the drug-like range, suggesting favorable oral bioavailability potential.
Frequently Asked Questions
Frequently Asked Questions
What is the CAS number of B 193?
The CAS number of B 193 is 124824-14-2.
What is the molecular formula of B 193?
The molecular formula of B 193 is C25H32Cl2N4O.
What is the molecular weight of B 193?
The molecular weight of B 193 is 474.20 g/mol.
Where can I buy B 193?
You can request a quote for B 193 directly from KEHONG BIO. Contact us or email info@kehongbio.com for pricing and availability.
Does KEHONG BIO offer custom synthesis for B 193?
Yes, KEHONG BIO provides custom synthesis services for B 193 and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.