WS 9659 B
TL;DR: WS 9659 B (CAS 123313-61-1) is a chemical compound with molecular formula C22H23ClN2O and molecular weight 366.15 g/mol, supplied by Kehong Biological (Henan Kehong Biological Technology Co., Ltd.) with CRO/CDMO custom synthesis services.
2-chloro-5-[(2,4,4-trimethylcyclohexen-1-yl)methyl]phenazin-1-one
Also Known As: Antibiotic WS-9659B, WS 9659 B, WS-9659B, WS-9659 B, 2-chloro-5-[(2,4,4-trimethylcyclohexen-1-yl)methyl]phenazin-1-one
| Molecular Formula | C22H23ClN2O |
|---|---|
| Molecular Weight | 366.15 g/mol |
| LogP | 4.9 |
| Topological Polar Surface Area | 32.7 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Exact Mass | 366.1499 |
| Heavy Atoms | 26 |
| Complexity | 756.0 |
Chemical Identifiers
| CAS Number | 123313-61-1 |
|---|---|
| SMILES | CC1=C(CCC(C1)(C)C)CN2C3=CC=CC=C3N=C4C2=CC=C(C4=O)Cl |
| InChIKey | UTTPOQJPJBHXNA-UHFFFAOYSA-N |
Product Overview
WS 9659 B (CAS 123313-61-1), with molecular formula C22H23ClN2O and molecular weight 366.15 g/mol. IUPAC: 2-chloro-5-[(2,4,4-trimethylcyclohexen-1-yl)methyl]phenazin-1-one.
Chemical Property Profile of WS 9659 B
Property Insights of WS 9659 B
The XLogP value of 4.9 indicates that WS 9659 B is lipophilic (fat-soluble), which may influence its absorption, distribution, and formulation strategy. With a topological polar surface area (TPSA) of 32.7 Ų, WS 9659 B exhibits relatively low polarity, potentially indicating favorable cell membrane permeability. Following Lipinski's Rule of Five, WS 9659 B has 0 hydrogen bond donor(s) and 3 hydrogen bond acceptor(s), all within the drug-like range, suggesting favorable oral bioavailability potential.
Frequently Asked Questions
Frequently Asked Questions
What is the CAS number of WS 9659 B?
The CAS number of WS 9659 B is 123313-61-1.
What is the molecular formula of WS 9659 B?
The molecular formula of WS 9659 B is C22H23ClN2O.
What is the molecular weight of WS 9659 B?
The molecular weight of WS 9659 B is 366.15 g/mol.
Where can I buy WS 9659 B?
You can request a quote for WS 9659 B directly from KEHONG BIO. Contact us or email info@kehongbio.com for pricing and availability.
Does KEHONG BIO offer custom synthesis for WS 9659 B?
Yes, KEHONG BIO provides custom synthesis services for WS 9659 B and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.