Preparation B 100
TL;DR: Preparation B 100 (CAS 117936-86-4) is a chemical compound with molecular formula C30H48 and molecular weight 408.38 g/mol, supplied by Kehong Biological (Henan Kehong Biological Technology Co., Ltd.) with CRO/CDMO custom synthesis services.
1-methyl-2-propan-2-ylbenzene;1-methyl-2-propan-2-ylcyclohexa-1,4-diene;1-methyl-2-propan-2-ylcyclohexene
Also Known As: Preparation B 100, Preparation B-100, C10-H14.C10-H18.C10-H16, 1-methyl-2-propan-2-ylbenzene;1-methyl-2-propan-2-ylcyclohexa-1,4-diene;1-methyl-2-propan-2-ylcyclohexene, 1-methyl-2-propan-2-ylbenzene,1-methyl-2-propan-2-ylcyclohexa-1,4-diene,1-methyl-2-propan-2-ylcyclohexene
| Molecular Formula | C30H48 |
|---|---|
| Molecular Weight | 408.38 g/mol |
| LogP | 9.96022 |
| Topological Polar Surface Area | 0.0 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 0 |
| Rotatable Bonds | 3 |
| Exact Mass | 408.3756 |
| Heavy Atoms | 30 |
| Complexity | 706.16016 |
Chemical Identifiers
| CAS Number | 117936-86-4 |
|---|---|
| SMILES | CC1=C(CCCC1)C(C)C.CC1=C(CC=CC1)C(C)C.CC1=CC=CC=C1C(C)C |
Product Overview
Preparation B 100 (CAS 117936-86-4), with molecular formula C30H48 and molecular weight 408.38 g/mol. IUPAC: 1-methyl-2-propan-2-ylbenzene;1-methyl-2-propan-2-ylcyclohexa-1,4-diene;1-methyl-2-propan-2-ylcyclohexene.
Chemical Property Profile of Preparation B 100
Property Insights of Preparation B 100
The XLogP value of 9.96022 indicates that Preparation B 100 is lipophilic (fat-soluble), which may influence its absorption, distribution, and formulation strategy. With a topological polar surface area (TPSA) of 0.0 Ų, Preparation B 100 exhibits relatively low polarity, potentially indicating favorable cell membrane permeability. Following Lipinski's Rule of Five, Preparation B 100 has 0 hydrogen bond donor(s) and 0 hydrogen bond acceptor(s), which may warrant consideration for formulation optimization.
Frequently Asked Questions
Frequently Asked Questions
What is the CAS number of Preparation B 100?
The CAS number of Preparation B 100 is 117936-86-4.
What is the molecular formula of Preparation B 100?
The molecular formula of Preparation B 100 is C30H48.
What is the molecular weight of Preparation B 100?
The molecular weight of Preparation B 100 is 408.38 g/mol.
Where can I buy Preparation B 100?
You can request a quote for Preparation B 100 directly from KEHONG BIO. Contact us or email info@kehongbio.com for pricing and availability.
Does KEHONG BIO offer custom synthesis for Preparation B 100?
Yes, KEHONG BIO provides custom synthesis services for Preparation B 100 and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.