B 220
TL;DR: B 220 (CAS 112229-05-7) is a chemical compound with molecular formula C20H22N4 and molecular weight 318.18 g/mol, supplied by Kehong Biological (Henan Kehong Biological Technology Co., Ltd.) with CRO/CDMO custom synthesis services.
2-(2,3-dimethylindolo[3,2-b]quinoxalin-6-yl)-N,N-dimethylethanamine
Also Known As: B220, Mach 2, 9-OH-B220, B 220, B-220
| Molecular Formula | C20H22N4 |
|---|---|
| Molecular Weight | 318.18 g/mol |
| LogP | 3.7 |
| Topological Polar Surface Area | 34.0 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Exact Mass | 318.18445 |
| Heavy Atoms | 24 |
| Complexity | 439.0 |
Chemical Identifiers
| CAS Number | 112229-05-7 |
|---|---|
| SMILES | CC1=CC2=C(C=C1C)N=C3C(=N2)C4=CC=CC=C4N3CCN(C)C |
| InChIKey | FPLSGFJELWCFTH-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 4 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
B 220 (CAS 112229-05-7), with molecular formula C20H22N4 and molecular weight 318.18 g/mol. IUPAC: 2-(2,3-dimethylindolo[3,2-b]quinoxalin-6-yl)-N,N-dimethylethanamine.
Chemical Property Profile of B 220
Property Insights of B 220
The XLogP value of 3.7 indicates that B 220 is lipophilic (fat-soluble), which may influence its absorption, distribution, and formulation strategy. With a topological polar surface area (TPSA) of 34.0 Ų, B 220 exhibits relatively low polarity, potentially indicating favorable cell membrane permeability. Following Lipinski's Rule of Five, B 220 has 0 hydrogen bond donor(s) and 3 hydrogen bond acceptor(s), all within the drug-like range, suggesting favorable oral bioavailability potential.
Frequently Asked Questions
Frequently Asked Questions
What is the CAS number of B 220?
The CAS number of B 220 is 112229-05-7.
What is the molecular formula of B 220?
The molecular formula of B 220 is C20H22N4.
What is the molecular weight of B 220?
The molecular weight of B 220 is 318.18 g/mol.
Where can I buy B 220?
You can request a quote for B 220 directly from KEHONG BIO. Contact us or email info@kehongbio.com for pricing and availability.
Does KEHONG BIO offer custom synthesis for B 220?
Yes, KEHONG BIO provides custom synthesis services for B 220 and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.