Racemomycin B sulfate
TL;DR: Racemomycin B sulfate (CAS 11076-96-3) is a chemical compound with molecular formula C31H60N12O14S and molecular weight 856.41 g/mol, supplied by Kehong Biological (Henan Kehong Biological Technology Co., Ltd.) with CRO/CDMO custom synthesis services.
Racemomycin B sulfate
[(2R,3R,4S,5R,6R)-5-[[3-amino-6-[[3-amino-6-(3,6-diaminohexanoylamino)hexanoyl]amino]hexanoyl]amino]-4-hydroxy-2-(hydroxymethyl)-6-[(7-hydroxy-4-oxo-1,3a,5,6,7,7a-hexahydroimidazo[4,5-c]pyridin-2-yl)amino]oxan-3-yl] carbamate;sulfuric acid
Also Known As: Racemomycin B sulfate, Streptothricin D sulfate, 4H-Imidazo(4,5-c)pyridin-4-one, 2-((2-(3-amino-6-(3-amino-6-(3,6-diaminohexanamido)hexanamido)hexanamido)-2-deoxy-beta-D-gulopyranosyl)amino)-3,3a,5,6,7,7a-hexahydro-7-hydroxy-, 6'-carbamate, sulfate, [(2R,3R,4S,5R,6R)-5-[[3-amino-6-[[3-amino-6-(3,6-diaminohexanoylamino)hexanoyl]amino]hexanoyl]amino]-4-hydroxy-2-(hydroxymethyl)-6-[(7-hydroxy-4-oxo-1,3a,5,6,7,7a-hexahydroimidazo[4,5-c]pyridin-2-yl)amino]oxan-3-yl] carbamate; sulfuric acid
| Molecular Formula | C31H60N12O14S |
|---|---|
| Molecular Weight | 856.41 g/mol |
| LogP | -7.179 |
| Topological Polar Surface Area | 462.0 Ų |
| Hydrogen Bond Donors | 16 |
| Hydrogen Bond Acceptors | 19 |
| Rotatable Bonds | 23 |
| Exact Mass | 856.4073 |
| Heavy Atoms | 58 |
| Complexity | 1350.0 |
Chemical Identifiers
| CAS Number | 11076-96-3 |
|---|---|
| SMILES | C1C(C2C(C(=O)N1)N=C(N2)N[C@H]3[C@@H]([C@@H]([C@H]([C@H](O3)CO)OC(=O)N)O)NC(=O)CC(CCCNC(=O)CC(CCCNC(=O)CC(CCCN)N)N)N)O.OS(=O)(=O)O |
| InChIKey | VLRZNBMECLLIGJ-YOCXTQSFSA-N |
Product Overview
Racemomycin B sulfate (CAS 11076-96-3), with molecular formula C31H60N12O14S and molecular weight 856.41 g/mol. IUPAC: [(2R,3R,4S,5R,6R)-5-[[3-amino-6-[[3-amino-6-(3,6-diaminohexanoylamino)hexanoyl]amino]hexanoyl]amino]-4-hydroxy-2-(hydroxymethyl)-6-[(7-hydroxy-4-oxo-1,3a,5,6,7,7a-hexahydroimidazo[4,5-c]pyridin-2-yl)amino]oxan-3-yl] carbamate;sulfuric acid.
Chemical Property Profile of Racemomycin B sulfate
Property Insights of Racemomycin B sulfate
The XLogP value of -7.179 indicates that Racemomycin B sulfate is hydrophilic (water-soluble), making it suitable for aqueous formulations and biological assay applications. The TPSA of 462.0 Ų indicates high polarity, suggesting Racemomycin B sulfate may have limited membrane permeability but good aqueous solubility. Following Lipinski's Rule of Five, Racemomycin B sulfate has 16 hydrogen bond donor(s) and 19 hydrogen bond acceptor(s), which may warrant consideration for formulation optimization.
Frequently Asked Questions
Frequently Asked Questions
What is the CAS number of Racemomycin B sulfate?
The CAS number of Racemomycin B sulfate is 11076-96-3.
What is the molecular formula of Racemomycin B sulfate?
The molecular formula of Racemomycin B sulfate is C31H60N12O14S.
What is the molecular weight of Racemomycin B sulfate?
The molecular weight of Racemomycin B sulfate is 856.41 g/mol.
Where can I buy Racemomycin B sulfate?
You can request a quote for Racemomycin B sulfate directly from KEHONG BIO. Contact us or email info@kehongbio.com for pricing and availability.
Does KEHONG BIO offer custom synthesis for Racemomycin B sulfate?
Yes, KEHONG BIO provides custom synthesis services for Racemomycin B sulfate and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.