B 24-76
TL;DR: B 24-76 (CAS 104970-08-3) is a chemical compound with molecular formula C19H23Cl2NO4 and molecular weight 399.10 g/mol, supplied by Kehong Biological (Henan Kehong Biological Technology Co., Ltd.) with CRO/CDMO custom synthesis services.
1-(2,4-dichlorophenoxy)-3-[2-(3,4-dimethoxyphenyl)ethylamino]propan-2-ol
Also Known As: B 24-76 hydrochloride, B-24-76, B 24-76, b-24/76, B-2476
| Molecular Formula | C19H23Cl2NO4 |
|---|---|
| Molecular Weight | 399.10 g/mol |
| LogP | 3.9 |
| Topological Polar Surface Area | 60.0 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Exact Mass | 399.1004 |
| Heavy Atoms | 26 |
| Complexity | 391.0 |
Chemical Identifiers
| CAS Number | 104970-08-3 |
|---|---|
| SMILES | COC1=C(C=C(C=C1)CCNCC(COC2=C(C=C(C=C2)Cl)Cl)O)OC |
| InChIKey | LHWFDNGVDKNZDS-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 3 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
B 24-76 (CAS 104970-08-3), with molecular formula C19H23Cl2NO4 and molecular weight 399.10 g/mol. IUPAC: 1-(2,4-dichlorophenoxy)-3-[2-(3,4-dimethoxyphenyl)ethylamino]propan-2-ol.
Chemical Property Profile of B 24-76
Property Insights of B 24-76
The XLogP value of 3.9 indicates that B 24-76 is lipophilic (fat-soluble), which may influence its absorption, distribution, and formulation strategy. The TPSA of 60.0 Ų falls within the moderate polarity range, balancing permeability and solubility for B 24-76. Following Lipinski's Rule of Five, B 24-76 has 2 hydrogen bond donor(s) and 5 hydrogen bond acceptor(s), all within the drug-like range, suggesting favorable oral bioavailability potential.
Frequently Asked Questions
Frequently Asked Questions
What is the CAS number of B 24-76?
The CAS number of B 24-76 is 104970-08-3.
What is the molecular formula of B 24-76?
The molecular formula of B 24-76 is C19H23Cl2NO4.
What is the molecular weight of B 24-76?
The molecular weight of B 24-76 is 399.10 g/mol.
Where can I buy B 24-76?
You can request a quote for B 24-76 directly from KEHONG BIO. Contact us or email info@kehongbio.com for pricing and availability.
Does KEHONG BIO offer custom synthesis for B 24-76?
Yes, KEHONG BIO provides custom synthesis services for B 24-76 and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.