Arphamenine B
TL;DR: Arphamenine B (CAS 103900-19-2) is a chemical compound with molecular formula C16H24N4O4 and molecular weight 336.18 g/mol, supplied by Kehong Biological (Henan Kehong Biological Technology Co., Ltd.) with CRO/CDMO custom synthesis services.
5-amino-8-(diaminomethylideneamino)-2-[(4-hydroxyphenyl)methyl]-4-oxooctanoic acid
Also Known As: Arphamenine B, Arphamenine B hemisulfate, 5-amino-8-(diaminomethylideneamino)-2-[(4-hydroxyphenyl)methyl]-4-oxooctanoic acid, 5-amino-8-guanidino-2-(4-hydroxyphenylmethyl)-4-oxooctanoic acid, A-(3-Amino-6-((aminoiminomethyl)amino)-2-oxohexyl)-4-hydroxybenzenepropanoic acid
| Molecular Formula | C16H24N4O4 |
|---|---|
| Molecular Weight | 336.18 g/mol |
| LogP | -3.0 |
| Topological Polar Surface Area | 165.0 Ų |
| Hydrogen Bond Donors | 5 |
| Hydrogen Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Exact Mass | 336.17975 |
| Heavy Atoms | 24 |
| Complexity | 443.0 |
Chemical Identifiers
| CAS Number | 103900-19-2 |
|---|---|
| SMILES | C1=CC(=CC=C1CC(CC(=O)C(CCCN=C(N)N)N)C(=O)O)O |
| InChIKey | RRJCLYMGCZJLBQ-UHFFFAOYSA-N |
Product Overview
Arphamenine B (CAS 103900-19-2), with molecular formula C16H24N4O4 and molecular weight 336.18 g/mol. IUPAC: 5-amino-8-(diaminomethylideneamino)-2-[(4-hydroxyphenyl)methyl]-4-oxooctanoic acid.
Chemical Property Profile of Arphamenine B
Property Insights of Arphamenine B
The XLogP value of -3.0 indicates that Arphamenine B is hydrophilic (water-soluble), making it suitable for aqueous formulations and biological assay applications. The TPSA of 165.0 Ų indicates high polarity, suggesting Arphamenine B may have limited membrane permeability but good aqueous solubility. Following Lipinski's Rule of Five, Arphamenine B has 5 hydrogen bond donor(s) and 6 hydrogen bond acceptor(s), all within the drug-like range, suggesting favorable oral bioavailability potential.
Frequently Asked Questions
Frequently Asked Questions
What is the CAS number of Arphamenine B?
The CAS number of Arphamenine B is 103900-19-2.
What is the molecular formula of Arphamenine B?
The molecular formula of Arphamenine B is C16H24N4O4.
What is the molecular weight of Arphamenine B?
The molecular weight of Arphamenine B is 336.18 g/mol.
Where can I buy Arphamenine B?
You can request a quote for Arphamenine B directly from KEHONG BIO. Contact us or email info@kehongbio.com for pricing and availability.
Does KEHONG BIO offer custom synthesis for Arphamenine B?
Yes, KEHONG BIO provides custom synthesis services for Arphamenine B and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.