Biphenomycin B
TL;DR: Biphenomycin B (CAS 100217-74-1) is a chemical compound with molecular formula C23H28N4O7 and molecular weight 472.20 g/mol, supplied by Kehong Biological (Henan Kehong Biological Technology Co., Ltd.) with CRO/CDMO custom synthesis services.
(8S,11S,14S)-14-amino-11-[(2R)-3-amino-2-hydroxypropyl]-5,17-dihydroxy-10,13-dioxo-9,12-diazatricyclo[14.3.1.12,6]henicosa-1(20),2(21),3,5,16,18-hexaene-8-carboxylic acid
Also Known As: Biphenomycin B, (8S,11S,14S)-14-amino-11-[(2R)-3-amino-2-hydroxypropyl]-5,17-dihydroxy-10,13-dioxo-9,12-diazatricyclo[14.3.1.12,6]henicosa-1(20),2(21),3,5,16,18-hexaene-8-carboxylic acid, 9,12-Diazatricyclo(14.3.1.12,6)heneicosa-1(20),2,4,6(21),16,18-hexaene-8-carboxylic acid, 14-amino-11-(3-amino-2-hydroxypropyl)-5,17-dihydroxy-10,13-dioxo-, (4S,7S,10S)-10-Amino-7-[(2R)-3-amino-2-hydroxypropyl]-1~4~,2~4~-dihydroxy-6,9-dioxo-5,8-diaza-1,2(1,3)-dibenzenacycloundecaphane-4-carboxylic acid, (8S,11S,14S)-14-amino-11-((2R)-3-amino-2-hydroxypropyl)-5,17-dihydroxy-10,13-dioxo-9,12-diazatricyclo(14.3.1.12,6)henicosa-1(20),2(21),3,5,16,18-hexaene-8-carboxylic acid
| Molecular Formula | C23H28N4O7 |
|---|---|
| Molecular Weight | 472.20 g/mol |
| LogP | -2.9 |
| Topological Polar Surface Area | 208.0 Ų |
| Hydrogen Bond Donors | 8 |
| Hydrogen Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Exact Mass | 472.1958 |
| Heavy Atoms | 34 |
| Complexity | 738.0 |
Chemical Identifiers
| CAS Number | 100217-74-1 |
|---|---|
| SMILES | C1[C@@H](C(=O)N[C@H](C(=O)N[C@@H](CC2=C(C=CC(=C2)C3=CC1=C(C=C3)O)O)C(=O)O)C[C@H](CN)O)N |
| InChIKey | OXLPMCIPYGNLJD-OWSLCNJRSA-N |
Product Overview
Biphenomycin B (CAS 100217-74-1), with molecular formula C23H28N4O7 and molecular weight 472.20 g/mol. IUPAC: (8S,11S,14S)-14-amino-11-[(2R)-3-amino-2-hydroxypropyl]-5,17-dihydroxy-10,13-dioxo-9,12-diazatricyclo[14.3.1.12,6]henicosa-1(20),2(21),3,5,16,18-hexaene-8-carboxylic acid.
Chemical Property Profile of Biphenomycin B
Property Insights of Biphenomycin B
The XLogP value of -2.9 indicates that Biphenomycin B is hydrophilic (water-soluble), making it suitable for aqueous formulations and biological assay applications. The TPSA of 208.0 Ų indicates high polarity, suggesting Biphenomycin B may have limited membrane permeability but good aqueous solubility. Following Lipinski's Rule of Five, Biphenomycin B has 8 hydrogen bond donor(s) and 9 hydrogen bond acceptor(s), which may warrant consideration for formulation optimization.
Frequently Asked Questions
Frequently Asked Questions
What is the CAS number of Biphenomycin B?
The CAS number of Biphenomycin B is 100217-74-1.
What is the molecular formula of Biphenomycin B?
The molecular formula of Biphenomycin B is C23H28N4O7.
What is the molecular weight of Biphenomycin B?
The molecular weight of Biphenomycin B is 472.20 g/mol.
Where can I buy Biphenomycin B?
You can request a quote for Biphenomycin B directly from KEHONG BIO. Contact us or email info@kehongbio.com for pricing and availability.
Does KEHONG BIO offer custom synthesis for Biphenomycin B?
Yes, KEHONG BIO provides custom synthesis services for Biphenomycin B and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.