Sulforhodamine B 2-acid fluoride
TL;DR: Sulforhodamine B 2-acid fluoride (CAS 98806-82-7) is a chemical compound with molecular formula C27H29FN2O6S2 and molecular weight 560.15 g/mol, supplied by Kehong Biological (Henan Kehong Biological Technology Co., Ltd.) with CRO/CDMO custom synthesis services.
4-[3-(diethylamino)-6-diethylazaniumylidenexanthen-9-yl]-3-fluorosulfonylbenzenesulfonate
Also Known As: Sulforhodamine B 2-acid fluoride, 4-[3-(diethylamino)-6-diethylazaniumylidenexanthen-9-yl]-3-fluorosulfonylbenzenesulfonate, 4-[6-(Diethylamino)-3-(diethyliminio)-3H-xanthen-9-yl]-3-(fluorosulfonyl)benzenesulfonate, SULFORHODAMINE B 2-ACID FLUORIDE FOR FLUORESCENCE 97+%, 4-(3-diethylamino-6-diethylazaniumylidene-xanthen-9-yl)-3-fluorosulfonyl-benzenesulfonate
| Molecular Formula | C27H29FN2O6S2 |
|---|---|
| Molecular Weight | 560.15 g/mol |
| LogP | 4.4251 |
| Topological Polar Surface Area | 110.73 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Exact Mass | 560.1451 |
| Heavy Atoms | 38 |
| Complexity | 1769.3014 |
Chemical Identifiers
| CAS Number | 98806-82-7 |
|---|---|
| SMILES | CCN(CC)C1=CC2=C(C=C1)C(=C3C=CC(=[N+](CC)CC)C=C3O2)C4=C(C=C(C=C4)S(=O)(=O)[O-])S(=O)(=O)F |
Product Overview
Sulforhodamine B 2-acid fluoride (CAS 98806-82-7), with molecular formula C27H29FN2O6S2 and molecular weight 560.15 g/mol. IUPAC: 4-[3-(diethylamino)-6-diethylazaniumylidenexanthen-9-yl]-3-fluorosulfonylbenzenesulfonate.
Chemical Property Profile of Sulforhodamine B 2-acid fluoride
Property Insights of Sulforhodamine B 2-acid fluoride
The XLogP value of 4.4251 indicates that Sulforhodamine B 2-acid fluoride is lipophilic (fat-soluble), which may influence its absorption, distribution, and formulation strategy. The TPSA of 110.73 Ų falls within the moderate polarity range, balancing permeability and solubility for Sulforhodamine B 2-acid fluoride. Following Lipinski's Rule of Five, Sulforhodamine B 2-acid fluoride has 0 hydrogen bond donor(s) and 7 hydrogen bond acceptor(s), which may warrant consideration for formulation optimization.
Frequently Asked Questions
Frequently Asked Questions
What is the CAS number of Sulforhodamine B 2-acid fluoride?
The CAS number of Sulforhodamine B 2-acid fluoride is 98806-82-7.
What is the molecular formula of Sulforhodamine B 2-acid fluoride?
The molecular formula of Sulforhodamine B 2-acid fluoride is C27H29FN2O6S2.
What is the molecular weight of Sulforhodamine B 2-acid fluoride?
The molecular weight of Sulforhodamine B 2-acid fluoride is 560.15 g/mol.
Where can I buy Sulforhodamine B 2-acid fluoride?
You can request a quote for Sulforhodamine B 2-acid fluoride directly from KEHONG BIO. Contact us or email info@kehongbio.com for pricing and availability.
Does KEHONG BIO offer custom synthesis for Sulforhodamine B 2-acid fluoride?
Yes, KEHONG BIO provides custom synthesis services for Sulforhodamine B 2-acid fluoride and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.