Teleocidin B 2
TL;DR: Teleocidin B 2 (CAS 95189-05-2) is a chemical compound with molecular formula C28H41N3O2 and molecular weight 451.32 g/mol, supplied by Kehong Biological (Henan Kehong Biological Technology Co., Ltd.) with CRO/CDMO custom synthesis services.
(6S,9S,14R,17S)-17-ethenyl-6-(hydroxymethyl)-10,14,17-trimethyl-9,14-di(propan-2-yl)-2,7,10-triazatetracyclo[9.7.1.04,19.013,18]nonadeca-1(18),3,11(19),12-tetraen-8-one
Also Known As: Teleocidin B-2, Teleocidin B 2, Teleocidin B2, Teleocidin B, (6S,9S,14R,17S)-17-ethenyl-6-(hydroxymethyl)-10,14,17-trimethyl-9,14-di(propan-2-yl)-2,7,10-triazatetracyclo[9.7.1.04,19.013,18]nonadeca-1(18),3,11(19),12-tetraen-8-one
| Molecular Formula | C28H41N3O2 |
|---|---|
| Molecular Weight | 451.32 g/mol |
| LogP | 6.5 |
| Topological Polar Surface Area | 68.4 Ų |
| Hydrogen Bond Donors | 3 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Exact Mass | 451.3199 |
| Heavy Atoms | 33 |
| Complexity | 753.0 |
Chemical Identifiers
| CAS Number | 95189-05-2 |
|---|---|
| SMILES | CC(C)[C@H]1C(=O)N[C@@H](CC2=CNC3=C4C(=CC(=C23)N1C)[C@@](CC[C@@]4(C)C=C)(C)C(C)C)CO |
| InChIKey | PEYTUVXFLCCGCC-FENHPFPBSA-N |
Product Overview
Teleocidin B 2 (CAS 95189-05-2), with molecular formula C28H41N3O2 and molecular weight 451.32 g/mol. IUPAC: (6S,9S,14R,17S)-17-ethenyl-6-(hydroxymethyl)-10,14,17-trimethyl-9,14-di(propan-2-yl)-2,7,10-triazatetracyclo[9.7.1.04,19.013,18]nonadeca-1(18),3,11(19),12-tetraen-8-one.
Chemical Property Profile of Teleocidin B 2
Property Insights of Teleocidin B 2
The XLogP value of 6.5 indicates that Teleocidin B 2 is lipophilic (fat-soluble), which may influence its absorption, distribution, and formulation strategy. The TPSA of 68.4 Ų falls within the moderate polarity range, balancing permeability and solubility for Teleocidin B 2. Following Lipinski's Rule of Five, Teleocidin B 2 has 3 hydrogen bond donor(s) and 3 hydrogen bond acceptor(s), which may warrant consideration for formulation optimization.
Frequently Asked Questions
Frequently Asked Questions
What is the CAS number of Teleocidin B 2?
The CAS number of Teleocidin B 2 is 95189-05-2.
What is the molecular formula of Teleocidin B 2?
The molecular formula of Teleocidin B 2 is C28H41N3O2.
What is the molecular weight of Teleocidin B 2?
The molecular weight of Teleocidin B 2 is 451.32 g/mol.
Where can I buy Teleocidin B 2?
You can request a quote for Teleocidin B 2 directly from KEHONG BIO. Contact us or email info@kehongbio.com for pricing and availability.
Does KEHONG BIO offer custom synthesis for Teleocidin B 2?
Yes, KEHONG BIO provides custom synthesis services for Teleocidin B 2 and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.