B 823-10
TL;DR: B 823-10 (CAS 92956-83-7) is a chemical compound with molecular formula C16H14F3N3O2S and molecular weight 369.08 g/mol, supplied by Kehong Biological (Henan Kehong Biological Technology Co., Ltd.) with CRO/CDMO custom synthesis services.
2-[(4-methoxy-3-methyl-2-pyridinyl)methylsulfinyl]-6-(trifluoromethyl)-1H-benzimidazole
Also Known As: B 823-10, B-823-10, 2-((3-Methyl-4-methoxy-2-pyridylmethyl)sulfinyl)-5-trifluoromethyl-1H-benzimidazole, H-200/68, 2-[(4-methoxy-3-methylpyridin-2-yl)methylsulfinyl]-6-(trifluoromethyl)-1H-benzimidazole
| Molecular Formula | C16H14F3N3O2S |
|---|---|
| Molecular Weight | 369.08 g/mol |
| LogP | 2.8 |
| Topological Polar Surface Area | 87.1 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Exact Mass | 369.0759 |
| Heavy Atoms | 25 |
| Complexity | 494.0 |
Chemical Identifiers
| CAS Number | 92956-83-7 |
|---|---|
| SMILES | CC1=C(C=CN=C1CS(=O)C2=NC3=C(N2)C=C(C=C3)C(F)(F)F)OC |
| InChIKey | OWWKQFJLNQHYQS-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 4 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
B 823-10 (CAS 92956-83-7), with molecular formula C16H14F3N3O2S and molecular weight 369.08 g/mol. IUPAC: 2-[(4-methoxy-3-methyl-2-pyridinyl)methylsulfinyl]-6-(trifluoromethyl)-1H-benzimidazole.
Chemical Property Profile of B 823-10
Property Insights of B 823-10
The XLogP value of 2.8 suggests moderate lipophilicity, balancing water solubility and membrane permeability for B 823-10. The TPSA of 87.1 Ų falls within the moderate polarity range, balancing permeability and solubility for B 823-10. Following Lipinski's Rule of Five, B 823-10 has 1 hydrogen bond donor(s) and 8 hydrogen bond acceptor(s), all within the drug-like range, suggesting favorable oral bioavailability potential.
Frequently Asked Questions
Frequently Asked Questions
What is the CAS number of B 823-10?
The CAS number of B 823-10 is 92956-83-7.
What is the molecular formula of B 823-10?
The molecular formula of B 823-10 is C16H14F3N3O2S.
What is the molecular weight of B 823-10?
The molecular weight of B 823-10 is 369.08 g/mol.
Where can I buy B 823-10?
You can request a quote for B 823-10 directly from KEHONG BIO. Contact us or email info@kehongbio.com for pricing and availability.
Does KEHONG BIO offer custom synthesis for B 823-10?
Yes, KEHONG BIO provides custom synthesis services for B 823-10 and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.