Neurokinin B
TL;DR: Neurokinin B (CAS 86933-75-7) is a chemical compound with molecular formula C55H79N13O14S2 and molecular weight 1209.53 g/mol, supplied by Kehong Biological (Henan Kehong Biological Technology Co., Ltd.) with CRO/CDMO custom synthesis services.
3-amino-4-[[1-[[1-[[1-[[1-[[1-[[1-[[2-[[1-[(1-amino-4-methylsulfanyl-1-oxobutan-2-yl)amino]-4-methyl-1-oxopentan-2-yl]amino]-2-oxoethyl]amino]-3-methyl-1-oxobutan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]amino]-3-carboxy-1-oxopropan-2-yl]amino]-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]amino]-4-methylsulfanyl-1-oxobutan-2-yl]amino]-4-oxobutanoic acid
Also Known As: Neurokinin B, Neurokinin beta, Neuromedin K, beta-Neurokinin, Porcine neurokinin B
| Molecular Formula | C55H79N13O14S2 |
|---|---|
| Molecular Weight | 1209.53 g/mol |
| LogP | -1.6 |
| Topological Polar Surface Area | 485.0 Ų |
| Hydrogen Bond Donors | 14 |
| Hydrogen Bond Acceptors | 18 |
| Rotatable Bonds | 38 |
| Exact Mass | 1209.5311 |
| Heavy Atoms | 84 |
| Complexity | 2220.0 |
Chemical Identifiers
| CAS Number | 86933-75-7 |
|---|---|
| SMILES | CC(C)CC(C(=O)NC(CCSC)C(=O)N)NC(=O)CNC(=O)C(C(C)C)NC(=O)C(CC1=CC=CC=C1)NC(=O)C(CC2=CC=CC=C2)NC(=O)C(CC(=O)O)NC(=O)C(CC3=CN=CN3)NC(=O)C(CCSC)NC(=O)C(CC(=O)O)N |
| InChIKey | NHXYSAFTNPANFK-UHFFFAOYSA-N |
Product Overview
Neurokinin B (CAS 86933-75-7), with molecular formula C55H79N13O14S2 and molecular weight 1209.53 g/mol. IUPAC: 3-amino-4-[[1-[[1-[[1-[[1-[[1-[[1-[[2-[[1-[(1-amino-4-methylsulfanyl-1-oxobutan-2-yl)amino]-4-methyl-1-oxopentan-2-yl]amino]-2-oxoethyl]amino]-3-methyl-1-oxobutan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]amino]-3-carboxy-1-oxopropan-2-yl]amino]-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]amino]-4-methylsulfanyl-1-oxobutan-2-yl]amino]-4-oxobutanoic acid.
Chemical Property Profile of Neurokinin B
Property Insights of Neurokinin B
The XLogP value of -1.6 indicates that Neurokinin B is hydrophilic (water-soluble), making it suitable for aqueous formulations and biological assay applications. The TPSA of 485.0 Ų indicates high polarity, suggesting Neurokinin B may have limited membrane permeability but good aqueous solubility. Following Lipinski's Rule of Five, Neurokinin B has 14 hydrogen bond donor(s) and 18 hydrogen bond acceptor(s), which may warrant consideration for formulation optimization.
Frequently Asked Questions
Frequently Asked Questions
What is the CAS number of Neurokinin B?
The CAS number of Neurokinin B is 86933-75-7.
What is the molecular formula of Neurokinin B?
The molecular formula of Neurokinin B is C55H79N13O14S2.
What is the molecular weight of Neurokinin B?
The molecular weight of Neurokinin B is 1209.53 g/mol.
Where can I buy Neurokinin B?
You can request a quote for Neurokinin B directly from KEHONG BIO. Contact us or email info@kehongbio.com for pricing and availability.
Does KEHONG BIO offer custom synthesis for Neurokinin B?
Yes, KEHONG BIO provides custom synthesis services for Neurokinin B and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.