Tetraphyllin B sulfate
TL;DR: Tetraphyllin B sulfate (CAS 85758-30-1) is a chemical compound with molecular formula C12H17NO10S and molecular weight 367.06 g/mol, supplied by Kehong Biological (Henan Kehong Biological Technology Co., Ltd.) with CRO/CDMO custom synthesis services.
[4-cyano-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxycyclopent-2-en-1-yl] hydrogen sulfate
Also Known As: Tetraphyllin B sulfate, Tetraphyllin B sulphate, epi-Tetraphyllin B sulfate, Epi-tetraphyllin b sulphate, Tetraphyllin b sulphate: epi-
| Molecular Formula | C12H17NO10S |
|---|---|
| Molecular Weight | 367.06 g/mol |
| LogP | -2.7 |
| Topological Polar Surface Area | 195.0 Ų |
| Hydrogen Bond Donors | 5 |
| Hydrogen Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Exact Mass | 367.0573 |
| Heavy Atoms | 24 |
| Complexity | 636.0 |
Chemical Identifiers
| CAS Number | 85758-30-1 |
|---|---|
| SMILES | C1C(C=CC1(C#N)OC2C(C(C(C(O2)CO)O)O)O)OS(=O)(=O)O |
| InChIKey | OXUIYNFEUWRHJJ-UHFFFAOYSA-N |
Product Overview
Tetraphyllin B sulfate (CAS 85758-30-1), with molecular formula C12H17NO10S and molecular weight 367.06 g/mol. IUPAC: [4-cyano-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxycyclopent-2-en-1-yl] hydrogen sulfate.
Chemical Property Profile of Tetraphyllin B sulfate
Property Insights of Tetraphyllin B sulfate
The XLogP value of -2.7 indicates that Tetraphyllin B sulfate is hydrophilic (water-soluble), making it suitable for aqueous formulations and biological assay applications. The TPSA of 195.0 Ų indicates high polarity, suggesting Tetraphyllin B sulfate may have limited membrane permeability but good aqueous solubility. Following Lipinski's Rule of Five, Tetraphyllin B sulfate has 5 hydrogen bond donor(s) and 11 hydrogen bond acceptor(s), which may warrant consideration for formulation optimization.
Frequently Asked Questions
Frequently Asked Questions
What is the CAS number of Tetraphyllin B sulfate?
The CAS number of Tetraphyllin B sulfate is 85758-30-1.
What is the molecular formula of Tetraphyllin B sulfate?
The molecular formula of Tetraphyllin B sulfate is C12H17NO10S.
What is the molecular weight of Tetraphyllin B sulfate?
The molecular weight of Tetraphyllin B sulfate is 367.06 g/mol.
Where can I buy Tetraphyllin B sulfate?
You can request a quote for Tetraphyllin B sulfate directly from KEHONG BIO. Contact us or email info@kehongbio.com for pricing and availability.
Does KEHONG BIO offer custom synthesis for Tetraphyllin B sulfate?
Yes, KEHONG BIO provides custom synthesis services for Tetraphyllin B sulfate and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.