Strep polysaccharide B Ia
TL;DR: Strep polysaccharide B Ia (CAS 84280-28-4) is a chemical compound with molecular formula C37H62N2O29 and molecular weight 998.34 g/mol, supplied by Kehong Biological (Henan Kehong Biological Technology Co., Ltd.) with CRO/CDMO custom synthesis services.
(2S,4S,5R,6R)-5-acetamido-2-[(2S,3R,4S,5S,6R)-2-[(2R,3S,4R,5R,6S)-5-acetamido-6-[(2R,3R,4R,5S,6R)-2,3-dihydroxy-6-(hydroxymethyl)-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-4-yl]oxy-4-hydroxy-2-(hydroxymethyl)oxan-3-yl]oxy-3,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl]oxy-4-hydroxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid
Also Known As: Strep polysaccharide B Ia, Streptococcal polysaccharide Ia group B, GlyTouCan:G88028XS, Epitope ID:141588, G88028XS
| Molecular Formula | C37H62N2O29 |
|---|---|
| Molecular Weight | 998.34 g/mol |
| LogP | -10.9 |
| Topological Polar Surface Area | 502.0 Ų |
| Hydrogen Bond Donors | 19 |
| Hydrogen Bond Acceptors | 29 |
| Rotatable Bonds | 18 |
| Exact Mass | 998.3438 |
| Heavy Atoms | 68 |
| Complexity | 1660.0 |
Chemical Identifiers
| CAS Number | 84280-28-4 |
|---|---|
| SMILES | CC(=O)N[C@@H]1[C@H](C[C@@](O[C@H]1[C@@H]([C@@H](CO)O)O)(C(=O)O)O[C@H]2[C@H]([C@H](O[C@H]([C@@H]2O)O[C@@H]3[C@H](O[C@H]([C@@H]([C@H]3O)NC(=O)C)O[C@@H]4[C@H]([C@@H](O[C@@H]([C@@H]4O[C@H]5[C@@H]([C@H]([C@@H]([C@H](O5)CO)O)O)O)CO)O)O)CO)CO)O)O |
| InChIKey | JTFSWAXKFBZNJE-IXANPYFWSA-N |
Product Overview
Strep polysaccharide B Ia (CAS 84280-28-4), with molecular formula C37H62N2O29 and molecular weight 998.34 g/mol. IUPAC: (2S,4S,5R,6R)-5-acetamido-2-[(2S,3R,4S,5S,6R)-2-[(2R,3S,4R,5R,6S)-5-acetamido-6-[(2R,3R,4R,5S,6R)-2,3-dihydroxy-6-(hydroxymethyl)-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-4-yl]oxy-4-hydroxy-2-(hydroxymethyl)oxan-3-yl]oxy-3,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl]oxy-4-hydroxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid.
Chemical Property Profile of Strep polysaccharide B Ia
Property Insights of Strep polysaccharide B Ia
The XLogP value of -10.9 indicates that Strep polysaccharide B Ia is hydrophilic (water-soluble), making it suitable for aqueous formulations and biological assay applications. The TPSA of 502.0 Ų indicates high polarity, suggesting Strep polysaccharide B Ia may have limited membrane permeability but good aqueous solubility. Following Lipinski's Rule of Five, Strep polysaccharide B Ia has 19 hydrogen bond donor(s) and 29 hydrogen bond acceptor(s), which may warrant consideration for formulation optimization.
Frequently Asked Questions
Frequently Asked Questions
What is the CAS number of Strep polysaccharide B Ia?
The CAS number of Strep polysaccharide B Ia is 84280-28-4.
What is the molecular formula of Strep polysaccharide B Ia?
The molecular formula of Strep polysaccharide B Ia is C37H62N2O29.
What is the molecular weight of Strep polysaccharide B Ia?
The molecular weight of Strep polysaccharide B Ia is 998.34 g/mol.
Where can I buy Strep polysaccharide B Ia?
You can request a quote for Strep polysaccharide B Ia directly from KEHONG BIO. Contact us or email info@kehongbio.com for pricing and availability.
Does KEHONG BIO offer custom synthesis for Strep polysaccharide B Ia?
Yes, KEHONG BIO provides custom synthesis services for Strep polysaccharide B Ia and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.