M and B 35769
TL;DR: M and B 35769 (CAS 83402-97-5) is a chemical compound with molecular formula C20H22Cl2N4O2 and molecular weight 420.11 g/mol, supplied by Kehong Biological (Henan Kehong Biological Technology Co., Ltd.) with CRO/CDMO custom synthesis services.
5-[3-[4-(4-chlorophenyl)phenoxy]propoxy]-6-methylpyrimidine-2,4-diamine;hydrochloride
Also Known As: M and B 35769, 2,4-Diamino-5-(3-(4-(4-chlorophenyl)phenoxy)propoxy)-6-methylpyrimidine monohydrochloride, 2,4-Pyrimidinediamine, 5-(3-((4'-chloro(1,1'-biphenyl)-4-yl)oxy)propoxy)-6-methyl-, monohydrochloride, 5-(3-((4'-Chloro(1,1'-biphenyl)-4-yl)oxy)propoxy)-6-methylpyrimidine-2,4-diamine hydrochloride, 5-[3-[ oxy]propoxy]-6-methylpyrimidine-2,4-diaminehydrochloride
| Molecular Formula | C20H22Cl2N4O2 |
|---|---|
| Molecular Weight | 420.11 g/mol |
| LogP | 4.53952 |
| Topological Polar Surface Area | 96.3 Ų |
| Hydrogen Bond Donors | 3 |
| Hydrogen Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Exact Mass | 420.11197 |
| Heavy Atoms | 28 |
| Complexity | 428.0 |
Chemical Identifiers
| CAS Number | 83402-97-5 |
|---|---|
| SMILES | CC1=C(C(=NC(=N1)N)N)OCCCOC2=CC=C(C=C2)C3=CC=C(C=C3)Cl.Cl |
| InChIKey | RUMUFGOFNCESLK-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 2 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
M and B 35769 (CAS 83402-97-5), with molecular formula C20H22Cl2N4O2 and molecular weight 420.11 g/mol. IUPAC: 5-[3-[4-(4-chlorophenyl)phenoxy]propoxy]-6-methylpyrimidine-2,4-diamine;hydrochloride.
Chemical Property Profile of M and B 35769
Property Insights of M and B 35769
The XLogP value of 4.53952 indicates that M and B 35769 is lipophilic (fat-soluble), which may influence its absorption, distribution, and formulation strategy. The TPSA of 96.3 Ų falls within the moderate polarity range, balancing permeability and solubility for M and B 35769. Following Lipinski's Rule of Five, M and B 35769 has 3 hydrogen bond donor(s) and 6 hydrogen bond acceptor(s), all within the drug-like range, suggesting favorable oral bioavailability potential.
Frequently Asked Questions
Frequently Asked Questions
What is the CAS number of M and B 35769?
The CAS number of M and B 35769 is 83402-97-5.
What is the molecular formula of M and B 35769?
The molecular formula of M and B 35769 is C20H22Cl2N4O2.
What is the molecular weight of M and B 35769?
The molecular weight of M and B 35769 is 420.11 g/mol.
Where can I buy M and B 35769?
You can request a quote for M and B 35769 directly from KEHONG BIO. Contact us or email info@kehongbio.com for pricing and availability.
Does KEHONG BIO offer custom synthesis for M and B 35769?
Yes, KEHONG BIO provides custom synthesis services for M and B 35769 and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.