B 749
TL;DR: B 749 (CAS 82736-00-3) is a chemical compound with molecular formula C30H29Cl2N5 and molecular weight 529.18 g/mol, supplied by Kehong Biological (Henan Kehong Biological Technology Co., Ltd.) with CRO/CDMO custom synthesis services.
N,5-bis(4-chlorophenyl)-3-[2-(diethylamino)ethylimino]phenazin-2-amine
Also Known As: Clofazimine Impurity 4, Clofazimine Impurity 7, CF Deriv 749, Clofazimine Impurity 10, B 749
| Molecular Formula | C30H29Cl2N5 |
|---|---|
| Molecular Weight | 529.18 g/mol |
| LogP | 7.1 |
| Topological Polar Surface Area | 43.2 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Exact Mass | 529.18 |
| Heavy Atoms | 37 |
| Complexity | 892.0 |
Chemical Identifiers
| CAS Number | 82736-00-3 |
|---|---|
| SMILES | CCN(CC)CCN=C1C=C2C(=NC3=CC=CC=C3N2C4=CC=C(C=C4)Cl)C=C1NC5=CC=C(C=C5)Cl |
| InChIKey | QETMIYRHIXHGJK-UHFFFAOYSA-N |
Product Overview
B 749 (CAS 82736-00-3), with molecular formula C30H29Cl2N5 and molecular weight 529.18 g/mol. IUPAC: N,5-bis(4-chlorophenyl)-3-[2-(diethylamino)ethylimino]phenazin-2-amine.
Chemical Property Profile of B 749
Property Insights of B 749
The XLogP value of 7.1 indicates that B 749 is lipophilic (fat-soluble), which may influence its absorption, distribution, and formulation strategy. With a topological polar surface area (TPSA) of 43.2 Ų, B 749 exhibits relatively low polarity, potentially indicating favorable cell membrane permeability. Following Lipinski's Rule of Five, B 749 has 1 hydrogen bond donor(s) and 5 hydrogen bond acceptor(s), which may warrant consideration for formulation optimization.
Frequently Asked Questions
Frequently Asked Questions
What is the CAS number of B 749?
The CAS number of B 749 is 82736-00-3.
What is the molecular formula of B 749?
The molecular formula of B 749 is C30H29Cl2N5.
What is the molecular weight of B 749?
The molecular weight of B 749 is 529.18 g/mol.
Where can I buy B 749?
You can request a quote for B 749 directly from KEHONG BIO. Contact us or email info@kehongbio.com for pricing and availability.
Does KEHONG BIO offer custom synthesis for B 749?
Yes, KEHONG BIO provides custom synthesis services for B 749 and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.