B 800
TL;DR: B 800 (CAS 78219-99-5) is a chemical compound with molecular formula C15H31Cl2N2O2P and molecular weight 372.15 g/mol, supplied by Kehong Biological (Henan Kehong Biological Technology Co., Ltd.) with CRO/CDMO custom synthesis services.
N,N-bis(2-chloroethyl)-3-heptyl-6-methyl-2-oxo-1,3,2λ5-oxazaphosphinan-2-amine
Also Known As: B 800, B-800, Tetrahydro-2-(bis(2-chloroethyl)amino)-3-heptyl-6-methyl-2H-1,3,2-oxazaphosphorine 2-oxide, 2H-1,3,2-Oxazaphosphorine, tetrahydro-2-(bis(2-chloroethyl)amino)-3-heptyl-6-methyl-, 2-oxide, N,N-bis(2-chloroethyl)-3-heptyl-6-methyl-2-oxo-1,3,2
| Molecular Formula | C15H31Cl2N2O2P |
|---|---|
| Molecular Weight | 372.15 g/mol |
| LogP | 4.9553 |
| Topological Polar Surface Area | 32.78 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Exact Mass | 372.15002 |
| Heavy Atoms | 22 |
| Complexity | 341.50415 |
Chemical Identifiers
| CAS Number | 78219-99-5 |
|---|---|
| SMILES | CCCCCCCN1CCC(OP1(=O)N(CCCl)CCCl)C |
Product Overview
B 800 (CAS 78219-99-5), with molecular formula C15H31Cl2N2O2P and molecular weight 372.15 g/mol. IUPAC: N,N-bis(2-chloroethyl)-3-heptyl-6-methyl-2-oxo-1,3,2λ5-oxazaphosphinan-2-amine.
Chemical Property Profile of B 800
Property Insights of B 800
The XLogP value of 4.9553 indicates that B 800 is lipophilic (fat-soluble), which may influence its absorption, distribution, and formulation strategy. With a topological polar surface area (TPSA) of 32.78 Ų, B 800 exhibits relatively low polarity, potentially indicating favorable cell membrane permeability. Following Lipinski's Rule of Five, B 800 has 0 hydrogen bond donor(s) and 2 hydrogen bond acceptor(s), all within the drug-like range, suggesting favorable oral bioavailability potential.
Frequently Asked Questions
Frequently Asked Questions
What is the CAS number of B 800?
The CAS number of B 800 is 78219-99-5.
What is the molecular formula of B 800?
The molecular formula of B 800 is C15H31Cl2N2O2P.
What is the molecular weight of B 800?
The molecular weight of B 800 is 372.15 g/mol.
Where can I buy B 800?
You can request a quote for B 800 directly from KEHONG BIO. Contact us or email info@kehongbio.com for pricing and availability.
Does KEHONG BIO offer custom synthesis for B 800?
Yes, KEHONG BIO provides custom synthesis services for B 800 and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.