B 736
TL;DR: B 736 (CAS 78219-86-0) is a chemical compound with molecular formula C10H21Cl2N2O2P and molecular weight 302.07 g/mol, supplied by Kehong Biological (Henan Kehong Biological Technology Co., Ltd.) with CRO/CDMO custom synthesis services.
N,N-bis(2-chloroethyl)-5-methyl-2-oxo-5-propyl-1,3,2λ5-oxazaphospholidin-2-amine
Also Known As: B 736, B-736, 2-(Bis(2-chloroethyl)amino)-5-methyl-5-propyl-1,3,2-oxazaphospholidine 2-oxide, 1,3,2-Oxazaphospholidine, 2-(bis(2-chloroethyl)amino)-5-methyl-5-propyl-, 2-oxide, N,N-bis(2-chloroethyl)-5-methyl-2-oxo-5-propyl-1,3,2
| Molecular Formula | C10H21Cl2N2O2P |
|---|---|
| Molecular Weight | 302.07 g/mol |
| LogP | 3.0527 |
| Topological Polar Surface Area | 41.57 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Exact Mass | 302.07178 |
| Heavy Atoms | 17 |
| Complexity | 287.47946 |
Chemical Identifiers
| CAS Number | 78219-86-0 |
|---|---|
| SMILES | CCCC1(CNP(=O)(O1)N(CCCl)CCCl)C |
Product Overview
B 736 (CAS 78219-86-0), with molecular formula C10H21Cl2N2O2P and molecular weight 302.07 g/mol. IUPAC: N,N-bis(2-chloroethyl)-5-methyl-2-oxo-5-propyl-1,3,2λ5-oxazaphospholidin-2-amine.
Chemical Property Profile of B 736
Property Insights of B 736
The XLogP value of 3.0527 indicates that B 736 is lipophilic (fat-soluble), which may influence its absorption, distribution, and formulation strategy. With a topological polar surface area (TPSA) of 41.57 Ų, B 736 exhibits relatively low polarity, potentially indicating favorable cell membrane permeability. Following Lipinski's Rule of Five, B 736 has 1 hydrogen bond donor(s) and 2 hydrogen bond acceptor(s), all within the drug-like range, suggesting favorable oral bioavailability potential.
Frequently Asked Questions
Frequently Asked Questions
What is the CAS number of B 736?
The CAS number of B 736 is 78219-86-0.
What is the molecular formula of B 736?
The molecular formula of B 736 is C10H21Cl2N2O2P.
What is the molecular weight of B 736?
The molecular weight of B 736 is 302.07 g/mol.
Where can I buy B 736?
You can request a quote for B 736 directly from KEHONG BIO. Contact us or email info@kehongbio.com for pricing and availability.
Does KEHONG BIO offer custom synthesis for B 736?
Yes, KEHONG BIO provides custom synthesis services for B 736 and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.