B 636
TL;DR: B 636 (CAS 78218-96-9) is a chemical compound with molecular formula C10H23Cl2N2O3P and molecular weight 320.08 g/mol, supplied by Kehong Biological (Henan Kehong Biological Technology Co., Ltd.) with CRO/CDMO custom synthesis services.
3-[[bis(2-chloroethyl)amino-propoxyphosphoryl]amino]propan-1-ol
Also Known As: B 636, B-636, Phosphorodiamidic acid, N,N-bis(2-chloroethyl)-N'-(3-hydroxypropyl)-, propyl ester, 3-[[bis(2-chloroethyl)amino-propoxyphosphoryl]amino]propan-1-ol, 3-({[bis(2-chloroethyl)amino](propoxy)phosphoryl}amino)propan-1-ol
| Molecular Formula | C10H23Cl2N2O3P |
|---|---|
| Molecular Weight | 320.08 g/mol |
| LogP | 2.2727 |
| Topological Polar Surface Area | 61.8 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Exact Mass | 320.08234 |
| Heavy Atoms | 18 |
| Complexity | 241.16269 |
Chemical Identifiers
| CAS Number | 78218-96-9 |
|---|---|
| SMILES | CCCOP(=O)(NCCCO)N(CCCl)CCCl |
Product Overview
B 636 (CAS 78218-96-9), with molecular formula C10H23Cl2N2O3P and molecular weight 320.08 g/mol. IUPAC: 3-[[bis(2-chloroethyl)amino-propoxyphosphoryl]amino]propan-1-ol.
Chemical Property Profile of B 636
Property Insights of B 636
The XLogP value of 2.2727 suggests moderate lipophilicity, balancing water solubility and membrane permeability for B 636. The TPSA of 61.8 Ų falls within the moderate polarity range, balancing permeability and solubility for B 636. Following Lipinski's Rule of Five, B 636 has 2 hydrogen bond donor(s) and 3 hydrogen bond acceptor(s), all within the drug-like range, suggesting favorable oral bioavailability potential.
Frequently Asked Questions
Frequently Asked Questions
What is the CAS number of B 636?
The CAS number of B 636 is 78218-96-9.
What is the molecular formula of B 636?
The molecular formula of B 636 is C10H23Cl2N2O3P.
What is the molecular weight of B 636?
The molecular weight of B 636 is 320.08 g/mol.
Where can I buy B 636?
You can request a quote for B 636 directly from KEHONG BIO. Contact us or email info@kehongbio.com for pricing and availability.
Does KEHONG BIO offer custom synthesis for B 636?
Yes, KEHONG BIO provides custom synthesis services for B 636 and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.