B 637
TL;DR: B 637 (CAS 78218-95-8) is a chemical compound with molecular formula C15H33Cl2N2O3P and molecular weight 390.16 g/mol, supplied by Kehong Biological (Henan Kehong Biological Technology Co., Ltd.) with CRO/CDMO custom synthesis services.
3-[[bis(2-chloroethyl)amino-octoxyphosphoryl]amino]propan-1-ol
Also Known As: B 637, B-637, Phosphorodiamidic acid, N,N-bis(2-chloroethyl)-N'-(3-hydroxypropyl)-, octyl ester, 3-[[bis(2-chloroethyl)amino-octoxyphosphoryl]amino]propan-1-ol, 3-({[bis(2-chloroethyl)amino](octyloxy)phosphoryl}amino)propan-1-ol
| Molecular Formula | C15H33Cl2N2O3P |
|---|---|
| Molecular Weight | 390.16 g/mol |
| LogP | 4.2232 |
| Topological Polar Surface Area | 61.8 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Exact Mass | 390.16058 |
| Heavy Atoms | 23 |
| Complexity | 306.44656 |
Chemical Identifiers
| CAS Number | 78218-95-8 |
|---|---|
| SMILES | CCCCCCCCOP(=O)(NCCCO)N(CCCl)CCCl |
Product Overview
B 637 (CAS 78218-95-8), with molecular formula C15H33Cl2N2O3P and molecular weight 390.16 g/mol. IUPAC: 3-[[bis(2-chloroethyl)amino-octoxyphosphoryl]amino]propan-1-ol.
Chemical Property Profile of B 637
Property Insights of B 637
The XLogP value of 4.2232 indicates that B 637 is lipophilic (fat-soluble), which may influence its absorption, distribution, and formulation strategy. The TPSA of 61.8 Ų falls within the moderate polarity range, balancing permeability and solubility for B 637. Following Lipinski's Rule of Five, B 637 has 2 hydrogen bond donor(s) and 3 hydrogen bond acceptor(s), all within the drug-like range, suggesting favorable oral bioavailability potential.
Frequently Asked Questions
Frequently Asked Questions
What is the CAS number of B 637?
The CAS number of B 637 is 78218-95-8.
What is the molecular formula of B 637?
The molecular formula of B 637 is C15H33Cl2N2O3P.
What is the molecular weight of B 637?
The molecular weight of B 637 is 390.16 g/mol.
Where can I buy B 637?
You can request a quote for B 637 directly from KEHONG BIO. Contact us or email info@kehongbio.com for pricing and availability.
Does KEHONG BIO offer custom synthesis for B 637?
Yes, KEHONG BIO provides custom synthesis services for B 637 and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.