B 700
TL;DR: B 700 (CAS 78218-86-7) is a chemical compound with molecular formula C9H20BrCl2N2O3P and molecular weight 383.98 g/mol, supplied by Kehong Biological (Henan Kehong Biological Technology Co., Ltd.) with CRO/CDMO custom synthesis services.
3-[[bis(2-chloroethyl)amino-(2-bromoethoxy)phosphoryl]amino]propan-1-ol
Also Known As: B 700, B-700, Phosphorodiamidic acid, N,N-bis(2-chloroethyl)-N'-(3-hydroxypropyl)-, (2-bromoethyl) ester, 2-Bromoethyl N,N-bis(2-chloroethyl)-N'-(3-hydroxypropyl)phosphorodiamidate, 3-({[bis(2-chloroethyl)amino](2-bromoethoxy)phosphoryl}amino)propan-1-ol
| Molecular Formula | C9H20BrCl2N2O3P |
|---|---|
| Molecular Weight | 383.98 g/mol |
| LogP | 2.2576 |
| Topological Polar Surface Area | 61.8 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Exact Mass | 383.9772 |
| Heavy Atoms | 18 |
| Complexity | 245.85263 |
Chemical Identifiers
| CAS Number | 78218-86-7 |
|---|---|
| SMILES | C(CNP(=O)(N(CCCl)CCCl)OCCBr)CO |
Product Overview
B 700 (CAS 78218-86-7), with molecular formula C9H20BrCl2N2O3P and molecular weight 383.98 g/mol. IUPAC: 3-[[bis(2-chloroethyl)amino-(2-bromoethoxy)phosphoryl]amino]propan-1-ol.
Chemical Property Profile of B 700
Property Insights of B 700
The XLogP value of 2.2576 suggests moderate lipophilicity, balancing water solubility and membrane permeability for B 700. The TPSA of 61.8 Ų falls within the moderate polarity range, balancing permeability and solubility for B 700. Following Lipinski's Rule of Five, B 700 has 2 hydrogen bond donor(s) and 3 hydrogen bond acceptor(s), all within the drug-like range, suggesting favorable oral bioavailability potential.
Frequently Asked Questions
Frequently Asked Questions
What is the CAS number of B 700?
The CAS number of B 700 is 78218-86-7.
What is the molecular formula of B 700?
The molecular formula of B 700 is C9H20BrCl2N2O3P.
What is the molecular weight of B 700?
The molecular weight of B 700 is 383.98 g/mol.
Where can I buy B 700?
You can request a quote for B 700 directly from KEHONG BIO. Contact us or email info@kehongbio.com for pricing and availability.
Does KEHONG BIO offer custom synthesis for B 700?
Yes, KEHONG BIO provides custom synthesis services for B 700 and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.