B 664
TL;DR: B 664 (CAS 78218-81-2) is a chemical compound with molecular formula C10H22Cl3N2O3P and molecular weight 354.04 g/mol, supplied by Kehong Biological (Henan Kehong Biological Technology Co., Ltd.) with CRO/CDMO custom synthesis services.
4-[[bis(2-chloroethyl)amino-(2-chloroethoxy)phosphoryl]amino]butan-1-ol
Also Known As: B 664, B-664, Phosphorodiamidic acid, N,N-bis(2-chloroethyl)-N'-(4-hydroxybutyl)-, (2-chloroethyl) ester, 2-Chloroethyl N,N-bis(2-chloroethyl)-N'-(4-hydroxybutyl)phosphorodiamidate, 4-({[bis(2-chloroethyl)amino](2-chloroethoxy)phosphoryl}amino)butan-1-ol
| Molecular Formula | C10H22Cl3N2O3P |
|---|---|
| Molecular Weight | 354.04 g/mol |
| LogP | 2.4916 |
| Topological Polar Surface Area | 61.8 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Exact Mass | 354.04337 |
| Heavy Atoms | 19 |
| Complexity | 256.17438 |
Chemical Identifiers
| CAS Number | 78218-81-2 |
|---|---|
| SMILES | C(CCO)CNP(=O)(N(CCCl)CCCl)OCCCl |
Product Overview
B 664 (CAS 78218-81-2), with molecular formula C10H22Cl3N2O3P and molecular weight 354.04 g/mol. IUPAC: 4-[[bis(2-chloroethyl)amino-(2-chloroethoxy)phosphoryl]amino]butan-1-ol.
Chemical Property Profile of B 664
Property Insights of B 664
The XLogP value of 2.4916 suggests moderate lipophilicity, balancing water solubility and membrane permeability for B 664. The TPSA of 61.8 Ų falls within the moderate polarity range, balancing permeability and solubility for B 664. Following Lipinski's Rule of Five, B 664 has 2 hydrogen bond donor(s) and 3 hydrogen bond acceptor(s), all within the drug-like range, suggesting favorable oral bioavailability potential.
Frequently Asked Questions
Frequently Asked Questions
What is the CAS number of B 664?
The CAS number of B 664 is 78218-81-2.
What is the molecular formula of B 664?
The molecular formula of B 664 is C10H22Cl3N2O3P.
What is the molecular weight of B 664?
The molecular weight of B 664 is 354.04 g/mol.
Where can I buy B 664?
You can request a quote for B 664 directly from KEHONG BIO. Contact us or email info@kehongbio.com for pricing and availability.
Does KEHONG BIO offer custom synthesis for B 664?
Yes, KEHONG BIO provides custom synthesis services for B 664 and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.