B 648
TL;DR: B 648 (CAS 78218-69-6) is a chemical compound with molecular formula C10H21Cl3NO4P and molecular weight 355.03 g/mol, supplied by Kehong Biological (Henan Kehong Biological Technology Co., Ltd.) with CRO/CDMO custom synthesis services.
2-[bis(2-chloroethyl)amino-(4-chlorobutoxy)phosphoryl]oxyethanol
Also Known As: B 648, B-648, 4-Chlorobutyl 2-hydroxyethyl-N,N-bis(2-chloroethyl)phosphoramidate, Phosphoramidic acid, N,N-bis(2-chloroethyl)-, O-(4-chlorobutyl)-O-(2-hydroxyethyl) ester, 2-[bis(2-chloroethyl)amino-(4-chlorobutoxy)phosphoryl]oxyethanol
| Molecular Formula | C10H21Cl3NO4P |
|---|---|
| Molecular Weight | 355.03 g/mol |
| LogP | 2.9186 |
| Topological Polar Surface Area | 59.0 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Exact Mass | 355.02737 |
| Heavy Atoms | 19 |
| Complexity | 254.92926 |
Chemical Identifiers
| CAS Number | 78218-69-6 |
|---|---|
| SMILES | C(CCCl)COP(=O)(N(CCCl)CCCl)OCCO |
Product Overview
B 648 (CAS 78218-69-6), with molecular formula C10H21Cl3NO4P and molecular weight 355.03 g/mol. IUPAC: 2-[bis(2-chloroethyl)amino-(4-chlorobutoxy)phosphoryl]oxyethanol.
Chemical Property Profile of B 648
Property Insights of B 648
The XLogP value of 2.9186 suggests moderate lipophilicity, balancing water solubility and membrane permeability for B 648. With a topological polar surface area (TPSA) of 59.0 Ų, B 648 exhibits relatively low polarity, potentially indicating favorable cell membrane permeability. Following Lipinski's Rule of Five, B 648 has 1 hydrogen bond donor(s) and 4 hydrogen bond acceptor(s), all within the drug-like range, suggesting favorable oral bioavailability potential.
Frequently Asked Questions
Frequently Asked Questions
What is the CAS number of B 648?
The CAS number of B 648 is 78218-69-6.
What is the molecular formula of B 648?
The molecular formula of B 648 is C10H21Cl3NO4P.
What is the molecular weight of B 648?
The molecular weight of B 648 is 355.03 g/mol.
Where can I buy B 648?
You can request a quote for B 648 directly from KEHONG BIO. Contact us or email info@kehongbio.com for pricing and availability.
Does KEHONG BIO offer custom synthesis for B 648?
Yes, KEHONG BIO provides custom synthesis services for B 648 and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.