B 688
TL;DR: B 688 (CAS 78149-85-6) is a chemical compound with molecular formula C9H19Cl2N2O2P and molecular weight 288.06 g/mol, supplied by Kehong Biological (Henan Kehong Biological Technology Co., Ltd.) with CRO/CDMO custom synthesis services.
N-(2-chloropropyl)-N-(3-chloropropyl)-2-oxo-1,3,2λ5-oxazaphosphinan-2-amine
Also Known As: B 688, B-688, Tetrahydro-2-(N-(2-chloropropyl)-N-(3-chloropropyl)amino)-2H-1,3,2-oxazaphosphorine 2-oxide, 2H-1,3,2-Oxazaphosphorine, tetrahydro-2-(N-(2-chloropropyl)-N-(3-chloropropyl)amino)-, 2-oxide, N-(2-chloropropyl)-N-(3-chloropropyl)-2-oxo-1,3,2
| Molecular Formula | C9H19Cl2N2O2P |
|---|---|
| Molecular Weight | 288.06 g/mol |
| LogP | 2.6626 |
| Topological Polar Surface Area | 41.57 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Exact Mass | 288.05612 |
| Heavy Atoms | 16 |
| Complexity | 243.66348 |
Chemical Identifiers
| CAS Number | 78149-85-6 |
|---|---|
| SMILES | CC(CN(CCCCl)P1(=O)NCCCO1)Cl |
Product Overview
B 688 (CAS 78149-85-6), with molecular formula C9H19Cl2N2O2P and molecular weight 288.06 g/mol. IUPAC: N-(2-chloropropyl)-N-(3-chloropropyl)-2-oxo-1,3,2λ5-oxazaphosphinan-2-amine.
Chemical Property Profile of B 688
Property Insights of B 688
The XLogP value of 2.6626 suggests moderate lipophilicity, balancing water solubility and membrane permeability for B 688. With a topological polar surface area (TPSA) of 41.57 Ų, B 688 exhibits relatively low polarity, potentially indicating favorable cell membrane permeability. Following Lipinski's Rule of Five, B 688 has 1 hydrogen bond donor(s) and 2 hydrogen bond acceptor(s), all within the drug-like range, suggesting favorable oral bioavailability potential.
Frequently Asked Questions
Frequently Asked Questions
What is the CAS number of B 688?
The CAS number of B 688 is 78149-85-6.
What is the molecular formula of B 688?
The molecular formula of B 688 is C9H19Cl2N2O2P.
What is the molecular weight of B 688?
The molecular weight of B 688 is 288.06 g/mol.
Where can I buy B 688?
You can request a quote for B 688 directly from KEHONG BIO. Contact us or email info@kehongbio.com for pricing and availability.
Does KEHONG BIO offer custom synthesis for B 688?
Yes, KEHONG BIO provides custom synthesis services for B 688 and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.