B 689
TL;DR: B 689 (CAS 78149-84-5) is a chemical compound with molecular formula C8H17Cl2N2O2P and molecular weight 274.04 g/mol, supplied by Kehong Biological (Henan Kehong Biological Technology Co., Ltd.) with CRO/CDMO custom synthesis services.
N-(2-chloroethyl)-N-(3-chloropropyl)-2-oxo-1,3,2λ5-oxazaphosphinan-2-amine
Also Known As: B 689, B-689, Tetrahydro-2-(N-(2-chloroethyl)-N-(3-chloropropyl)amino)-2H-1,3,2-oxazaphosphorine 2-oxide, 2H-1,3,2-Oxazaphosphorine, tetrahydro-2-(N-(2-chloroethyl)-N-(3-chloropropyl)amino)-, 2-oxide, N-(2-chloroethyl)-N-(3-chloropropyl)-2-oxo-1,3,2
| Molecular Formula | C8H17Cl2N2O2P |
|---|---|
| Molecular Weight | 274.04 g/mol |
| LogP | 2.2741 |
| Topological Polar Surface Area | 41.57 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Exact Mass | 274.04047 |
| Heavy Atoms | 15 |
| Complexity | 220.68721 |
Chemical Identifiers
| CAS Number | 78149-84-5 |
|---|---|
| SMILES | C1CNP(=O)(OC1)N(CCCCl)CCCl |
Product Overview
B 689 (CAS 78149-84-5), with molecular formula C8H17Cl2N2O2P and molecular weight 274.04 g/mol. IUPAC: N-(2-chloroethyl)-N-(3-chloropropyl)-2-oxo-1,3,2λ5-oxazaphosphinan-2-amine.
Chemical Property Profile of B 689
Property Insights of B 689
The XLogP value of 2.2741 suggests moderate lipophilicity, balancing water solubility and membrane permeability for B 689. With a topological polar surface area (TPSA) of 41.57 Ų, B 689 exhibits relatively low polarity, potentially indicating favorable cell membrane permeability. Following Lipinski's Rule of Five, B 689 has 1 hydrogen bond donor(s) and 2 hydrogen bond acceptor(s), all within the drug-like range, suggesting favorable oral bioavailability potential.
Frequently Asked Questions
Frequently Asked Questions
What is the CAS number of B 689?
The CAS number of B 689 is 78149-84-5.
What is the molecular formula of B 689?
The molecular formula of B 689 is C8H17Cl2N2O2P.
What is the molecular weight of B 689?
The molecular weight of B 689 is 274.04 g/mol.
Where can I buy B 689?
You can request a quote for B 689 directly from KEHONG BIO. Contact us or email info@kehongbio.com for pricing and availability.
Does KEHONG BIO offer custom synthesis for B 689?
Yes, KEHONG BIO provides custom synthesis services for B 689 and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.