Urolithin B glucoside
TL;DR: Urolithin B glucoside (CAS 768382-45-2) is a chemical compound with molecular formula C19H18O8 and molecular weight 374.10 g/mol, supplied by Kehong Biological (Henan Kehong Biological Technology Co., Ltd.) with CRO/CDMO custom synthesis services.
3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybenzo[c]chromen-6-one
Also Known As: Urolithin B glucoside, J3.637.465I, 3-(beta-D-Glucopyranosyloxy)-6H-dibenzo[b,d]pyran-6-one, 3-(3,4,5-Trihydroxy-6-hydroxymethyl-tetrahydro-pyran-2-yloxy)-benzo[c]chromen-6-one, 3-{[3,4,5-TRIHYDROXY-6-(HYDROXYMETHYL)OXAN-2-YL]OXY}-6H-BENZO[C]CHROMEN-6-ONE
| Molecular Formula | C19H18O8 |
|---|---|
| Molecular Weight | 374.10 g/mol |
| LogP | 0.1249 |
| Topological Polar Surface Area | 129.59 Ų |
| Hydrogen Bond Donors | 4 |
| Hydrogen Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Exact Mass | 374.10016 |
| Heavy Atoms | 27 |
| Complexity | 1027.0642 |
Chemical Identifiers
| CAS Number | 768382-45-2 |
|---|---|
| SMILES | C1=CC=C2C(=C1)C3=C(C=C(C=C3)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)OC2=O |
Product Overview
Urolithin B glucoside (CAS 768382-45-2), with molecular formula C19H18O8 and molecular weight 374.10 g/mol. IUPAC: 3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybenzo[c]chromen-6-one.
Chemical Property Profile of Urolithin B glucoside
Property Insights of Urolithin B glucoside
The XLogP value of 0.1249 suggests moderate lipophilicity, balancing water solubility and membrane permeability for Urolithin B glucoside. The TPSA of 129.59 Ų falls within the moderate polarity range, balancing permeability and solubility for Urolithin B glucoside. Following Lipinski's Rule of Five, Urolithin B glucoside has 4 hydrogen bond donor(s) and 8 hydrogen bond acceptor(s), all within the drug-like range, suggesting favorable oral bioavailability potential.
Frequently Asked Questions
Frequently Asked Questions
What is the CAS number of Urolithin B glucoside?
The CAS number of Urolithin B glucoside is 768382-45-2.
What is the molecular formula of Urolithin B glucoside?
The molecular formula of Urolithin B glucoside is C19H18O8.
What is the molecular weight of Urolithin B glucoside?
The molecular weight of Urolithin B glucoside is 374.10 g/mol.
Where can I buy Urolithin B glucoside?
You can request a quote for Urolithin B glucoside directly from KEHONG BIO. Contact us or email info@kehongbio.com for pricing and availability.
Does KEHONG BIO offer custom synthesis for Urolithin B glucoside?
Yes, KEHONG BIO provides custom synthesis services for Urolithin B glucoside and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.