Piptocarphin B B822833F266
TL;DR: Piptocarphin B B822833F266 (CAS 76215-49-1) is a chemical compound with molecular formula C22H28O9 and molecular weight 436.17 g/mol, supplied by Kehong Biological (Henan Kehong Biological Technology Co., Ltd.) with CRO/CDMO custom synthesis services.
[(2Z)-6-(acetyloxymethyl)-10,11-dihydroxy-1,10-dimethyl-5-oxo-4,14-dioxatricyclo[9.2.1.03,7]tetradeca-2,6-dien-8-yl] (E)-2-methylbut-2-enoate
Also Known As: Piptocarphin B, PIPTOCARPHIN B B822833F266
| Molecular Formula | C22H28O9 |
|---|---|
| Molecular Weight | 436.17 g/mol |
| LogP | 1.5772 |
| Topological Polar Surface Area | 128.59 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Exact Mass | 436.17334 |
| Heavy Atoms | 31 |
| Complexity | 909.9424 |
Chemical Identifiers
| CAS Number | 76215-49-1 |
|---|---|
| SMILES | C/C=C(\C)/C(=O)OC1CC(C2(CCC(O2)(/C=C\3/C1=C(C(=O)O3)COC(=O)C)C)O)(C)O |
Product Overview
Piptocarphin B B822833F266 (CAS 76215-49-1), with molecular formula C22H28O9 and molecular weight 436.17 g/mol. IUPAC: [(2Z)-6-(acetyloxymethyl)-10,11-dihydroxy-1,10-dimethyl-5-oxo-4,14-dioxatricyclo[9.2.1.03,7]tetradeca-2,6-dien-8-yl] (E)-2-methylbut-2-enoate.
Chemical Property Profile of Piptocarphin B B822833F266
Property Insights of Piptocarphin B B822833F266
The XLogP value of 1.5772 suggests moderate lipophilicity, balancing water solubility and membrane permeability for Piptocarphin B B822833F266. The TPSA of 128.59 Ų falls within the moderate polarity range, balancing permeability and solubility for Piptocarphin B B822833F266. Following Lipinski's Rule of Five, Piptocarphin B B822833F266 has 2 hydrogen bond donor(s) and 9 hydrogen bond acceptor(s), all within the drug-like range, suggesting favorable oral bioavailability potential.
Frequently Asked Questions
Frequently Asked Questions
What is the CAS number of Piptocarphin B B822833F266?
The CAS number of Piptocarphin B B822833F266 is 76215-49-1.
What is the molecular formula of Piptocarphin B B822833F266?
The molecular formula of Piptocarphin B B822833F266 is C22H28O9.
What is the molecular weight of Piptocarphin B B822833F266?
The molecular weight of Piptocarphin B B822833F266 is 436.17 g/mol.
Where can I buy Piptocarphin B B822833F266?
You can request a quote for Piptocarphin B B822833F266 directly from KEHONG BIO. Contact us or email info@kehongbio.com for pricing and availability.
Does KEHONG BIO offer custom synthesis for Piptocarphin B B822833F266?
Yes, KEHONG BIO provides custom synthesis services for Piptocarphin B B822833F266 and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.