Dihydroteleocidin B
TL;DR: Dihydroteleocidin B (CAS 7491-76-1) is a chemical compound with molecular formula C28H43N3O2 and molecular weight 453.34 g/mol, supplied by Kehong Biological (Henan Kehong Biological Technology Co., Ltd.) with CRO/CDMO custom synthesis services.
(6S,9S,14R,17S)-17-ethyl-6-(hydroxymethyl)-10,14,17-trimethyl-9,14-di(propan-2-yl)-2,7,10-triazatetracyclo[9.7.1.04,19.013,18]nonadeca-1(18),3,11(19),12-tetraen-8-one
Also Known As: Dihydroteleocidin B, Teleocidin B, dihydro-, DIHYDROTELEOCIDIN, (6S,9S,14R,17S)-17-ethyl-6-(hydroxymethyl)-10,14,17-trimethyl-9,14-di(propan-2-yl)-2,7,10-triazatetracyclo[9.7.1.04,19.013,18]nonadeca-1(18),3,11(19),12-tetraen-8-one, 6H-Benzo(g)(1,4)diazonino(7,6,5-cd)indol-6-one, 13-ethyl-1,3,4,5,7,8,10,11,12,13-decahydro-4-(hydroxymethyl)-8,10,13-trimethyl-7,10-bis(1-methylethyl)-, (4S-(4R*,7R*,10S*,13S*))-
| Molecular Formula | C28H43N3O2 |
|---|---|
| Molecular Weight | 453.34 g/mol |
| LogP | 5.0371 |
| Topological Polar Surface Area | 68.36 Ų |
| Hydrogen Bond Donors | 3 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Exact Mass | 453.33554 |
| Heavy Atoms | 33 |
| Complexity | 1055.0801 |
Chemical Identifiers
| CAS Number | 7491-76-1 |
|---|---|
| SMILES | CC[C@]1(CC[C@](C2=CC3=C4C(=CNC4=C21)C[C@H](NC(=O)[C@@H](N3C)C(C)C)CO)(C)C(C)C)C |
Product Overview
Dihydroteleocidin B (CAS 7491-76-1), with molecular formula C28H43N3O2 and molecular weight 453.34 g/mol. IUPAC: (6S,9S,14R,17S)-17-ethyl-6-(hydroxymethyl)-10,14,17-trimethyl-9,14-di(propan-2-yl)-2,7,10-triazatetracyclo[9.7.1.04,19.013,18]nonadeca-1(18),3,11(19),12-tetraen-8-one.
Chemical Property Profile of Dihydroteleocidin B
Property Insights of Dihydroteleocidin B
The XLogP value of 5.0371 indicates that Dihydroteleocidin B is lipophilic (fat-soluble), which may influence its absorption, distribution, and formulation strategy. The TPSA of 68.36 Ų falls within the moderate polarity range, balancing permeability and solubility for Dihydroteleocidin B. Following Lipinski's Rule of Five, Dihydroteleocidin B has 3 hydrogen bond donor(s) and 3 hydrogen bond acceptor(s), which may warrant consideration for formulation optimization.
Frequently Asked Questions
Frequently Asked Questions
What is the CAS number of Dihydroteleocidin B?
The CAS number of Dihydroteleocidin B is 7491-76-1.
What is the molecular formula of Dihydroteleocidin B?
The molecular formula of Dihydroteleocidin B is C28H43N3O2.
What is the molecular weight of Dihydroteleocidin B?
The molecular weight of Dihydroteleocidin B is 453.34 g/mol.
Where can I buy Dihydroteleocidin B?
You can request a quote for Dihydroteleocidin B directly from KEHONG BIO. Contact us or email info@kehongbio.com for pricing and availability.
Does KEHONG BIO offer custom synthesis for Dihydroteleocidin B?
Yes, KEHONG BIO provides custom synthesis services for Dihydroteleocidin B and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.