Dihydroteleocidin B amine
TL;DR: Dihydroteleocidin B amine (CAS 7482-50-0) is a chemical compound with molecular formula C28H43N3O2 and molecular weight 453.34 g/mol, supplied by Kehong Biological (Henan Kehong Biological Technology Co., Ltd.) with CRO/CDMO custom synthesis services.
14-amino-7-ethyl-4,7,19-trimethyl-4,18-di(propan-2-yl)-16-oxa-10,19-diazatetracyclo[10.7.1.03,8.09,20]icosa-1(20),2,8,11-tetraen-17-one
Also Known As: Hydroteleocidin B amine, Dihydroteleocidin B amine, Benzo(j)pyrrolo(4,3,2-gh)(4,1)benzoxazonin-6(1H)-one, 3,4,7,8,10,11,12,13-octahydro-4-(aminomethyl)-7,10-bis(1-methylethyl)-13-ethyl-8,10,13-trimethyl-, 4-Amino-14-ethyl-9,11,14-trimethyl-8,11-di(propan-2-yl)-1,3,4,5,8,9,11,12,13,14-decahydro-7H-benzo[g][1,4]oxazecino[7,6,5-cd]indol-7-one, RefChem:338271
| Molecular Formula | C28H43N3O2 |
|---|---|
| Molecular Weight | 453.34 g/mol |
| LogP | 7.1 |
| Topological Polar Surface Area | 71.4 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Exact Mass | 453.33554 |
| Heavy Atoms | 33 |
| Complexity | 726.0 |
Chemical Identifiers
| CAS Number | 7482-50-0 |
|---|---|
| SMILES | CCC1(CCC(C2=CC3=C4C(=CNC4=C21)CC(COC(=O)C(N3C)C(C)C)N)(C)C(C)C)C |
| InChIKey | QBRXWCIFOZNNSM-UHFFFAOYSA-N |
Product Overview
Dihydroteleocidin B amine (CAS 7482-50-0), with molecular formula C28H43N3O2 and molecular weight 453.34 g/mol. IUPAC: 14-amino-7-ethyl-4,7,19-trimethyl-4,18-di(propan-2-yl)-16-oxa-10,19-diazatetracyclo[10.7.1.03,8.09,20]icosa-1(20),2,8,11-tetraen-17-one.
Chemical Property Profile of Dihydroteleocidin B amine
Property Insights of Dihydroteleocidin B amine
The XLogP value of 7.1 indicates that Dihydroteleocidin B amine is lipophilic (fat-soluble), which may influence its absorption, distribution, and formulation strategy. The TPSA of 71.4 Ų falls within the moderate polarity range, balancing permeability and solubility for Dihydroteleocidin B amine. Following Lipinski's Rule of Five, Dihydroteleocidin B amine has 2 hydrogen bond donor(s) and 4 hydrogen bond acceptor(s), which may warrant consideration for formulation optimization.
Frequently Asked Questions
Frequently Asked Questions
What is the CAS number of Dihydroteleocidin B amine?
The CAS number of Dihydroteleocidin B amine is 7482-50-0.
What is the molecular formula of Dihydroteleocidin B amine?
The molecular formula of Dihydroteleocidin B amine is C28H43N3O2.
What is the molecular weight of Dihydroteleocidin B amine?
The molecular weight of Dihydroteleocidin B amine is 453.34 g/mol.
Where can I buy Dihydroteleocidin B amine?
You can request a quote for Dihydroteleocidin B amine directly from KEHONG BIO. Contact us or email info@kehongbio.com for pricing and availability.
Does KEHONG BIO offer custom synthesis for Dihydroteleocidin B amine?
Yes, KEHONG BIO provides custom synthesis services for Dihydroteleocidin B amine and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.