Pyrenocine B
TL;DR: Pyrenocine B (CAS 72674-29-4) is a chemical compound with molecular formula C11H14O5 and molecular weight 226.08 g/mol, supplied by Kehong Biological (Henan Kehong Biological Technology Co., Ltd.) with CRO/CDMO custom synthesis services.
5-(3-hydroxybutanoyl)-4-methoxy-6-methylpyran-2-one
Also Known As: Pyrenocin B, Pyrenocine B, pyrenocineB, Pyrenocine B putative, 5-(3-hydroxybutanoyl)-4-methoxy-6-methylpyran-2-one
| Molecular Formula | C11H14O5 |
|---|---|
| Molecular Weight | 226.08 g/mol |
| LogP | -0.1 |
| Topological Polar Surface Area | 72.8 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Exact Mass | 226.08412 |
| Heavy Atoms | 16 |
| Complexity | 378.0 |
Chemical Identifiers
| CAS Number | 72674-29-4 |
|---|---|
| SMILES | CC1=C(C(=CC(=O)O1)OC)C(=O)CC(C)O |
| InChIKey | NXDGLHJHHJJTSZ-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 1 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Pyrenocine B (CAS 72674-29-4), with molecular formula C11H14O5 and molecular weight 226.08 g/mol. IUPAC: 5-(3-hydroxybutanoyl)-4-methoxy-6-methylpyran-2-one.
Chemical Property Profile of Pyrenocine B
Property Insights of Pyrenocine B
The XLogP value of -0.1 indicates that Pyrenocine B is hydrophilic (water-soluble), making it suitable for aqueous formulations and biological assay applications. The TPSA of 72.8 Ų falls within the moderate polarity range, balancing permeability and solubility for Pyrenocine B. Following Lipinski's Rule of Five, Pyrenocine B has 1 hydrogen bond donor(s) and 5 hydrogen bond acceptor(s), all within the drug-like range, suggesting favorable oral bioavailability potential.
Frequently Asked Questions
Frequently Asked Questions
What is the CAS number of Pyrenocine B?
The CAS number of Pyrenocine B is 72674-29-4.
What is the molecular formula of Pyrenocine B?
The molecular formula of Pyrenocine B is C11H14O5.
What is the molecular weight of Pyrenocine B?
The molecular weight of Pyrenocine B is 226.08 g/mol.
Where can I buy Pyrenocine B?
You can request a quote for Pyrenocine B directly from KEHONG BIO. Contact us or email info@kehongbio.com for pricing and availability.
Does KEHONG BIO offer custom synthesis for Pyrenocine B?
Yes, KEHONG BIO provides custom synthesis services for Pyrenocine B and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.