Clazamycin B hydrochloride
TL;DR: Clazamycin B hydrochloride (CAS 71829-72-6) is a chemical compound with molecular formula C7H10Cl2N2O and molecular weight 208.02 g/mol, supplied by Kehong Biological (Henan Kehong Biological Technology Co., Ltd.) with CRO/CDMO custom synthesis services.
(2S,8S)-2-chloro-5-imino-2,3-dihydro-1H-pyrrolizin-8-ol;hydrochloride
Also Known As: Clazamycin B HCl, Clazamycin B hydrochloride, Clazamycin A hydrochloride, 1H-Pyrrolizin-7a(5H)-ol, 2,3-dihydro-2-chloro-5-imino-, monohydrochloride, (2S-cis)-, 2,3-Dihydro-2-chloro-5-imino-1H-pyrrolizin-7a(5H)-ol monohydrochloride (2S-cis)-
| Molecular Formula | C7H10Cl2N2O |
|---|---|
| Molecular Weight | 208.02 g/mol |
| LogP | 0.95697 |
| Topological Polar Surface Area | 47.32 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 0 |
| Exact Mass | 208.01701 |
| Heavy Atoms | 12 |
| Complexity | 243.56088 |
Chemical Identifiers
| CAS Number | 71829-72-6 |
|---|---|
| SMILES | C1[C@@H](CN2[C@]1(C=CC2=N)O)Cl.Cl |
Product Overview
Clazamycin B hydrochloride (CAS 71829-72-6), with molecular formula C7H10Cl2N2O and molecular weight 208.02 g/mol. IUPAC: (2S,8S)-2-chloro-5-imino-2,3-dihydro-1H-pyrrolizin-8-ol;hydrochloride.
Chemical Property Profile of Clazamycin B hydrochloride
Property Insights of Clazamycin B hydrochloride
The XLogP value of 0.95697 suggests moderate lipophilicity, balancing water solubility and membrane permeability for Clazamycin B hydrochloride. With a topological polar surface area (TPSA) of 47.32 Ų, Clazamycin B hydrochloride exhibits relatively low polarity, potentially indicating favorable cell membrane permeability. Following Lipinski's Rule of Five, Clazamycin B hydrochloride has 2 hydrogen bond donor(s) and 2 hydrogen bond acceptor(s), all within the drug-like range, suggesting favorable oral bioavailability potential.
Frequently Asked Questions
Frequently Asked Questions
What is the CAS number of Clazamycin B hydrochloride?
The CAS number of Clazamycin B hydrochloride is 71829-72-6.
What is the molecular formula of Clazamycin B hydrochloride?
The molecular formula of Clazamycin B hydrochloride is C7H10Cl2N2O.
What is the molecular weight of Clazamycin B hydrochloride?
The molecular weight of Clazamycin B hydrochloride is 208.02 g/mol.
Where can I buy Clazamycin B hydrochloride?
You can request a quote for Clazamycin B hydrochloride directly from KEHONG BIO. Contact us or email info@kehongbio.com for pricing and availability.
Does KEHONG BIO offer custom synthesis for Clazamycin B hydrochloride?
Yes, KEHONG BIO provides custom synthesis services for Clazamycin B hydrochloride and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.