B 617
TL;DR: B 617 (CAS 70772-72-4) is a chemical compound with molecular formula C10H21Cl2N2O2P and molecular weight 302.07 g/mol, supplied by Kehong Biological (Henan Kehong Biological Technology Co., Ltd.) with CRO/CDMO custom synthesis services.
N,N-bis(2-chloroethyl)-4,4,6-trimethyl-2-oxo-1,3,2λ5-oxazaphosphinan-2-amine
Also Known As: B 617, B-617, Tetrahydro-2-(bis(2-chloroethyl)amino)-4,4,6-trimethyl-2H-1,3,2-oxazaphosphorine 2-oxide, 2H-1,3,2-Oxazaphosphorine, tetrahydro-2-(bis(2-chloroethyl)amino)-4,4,6-trimethyl-, 2-oxide, N,N-bis(2-chloroethyl)-4,4,6-trimethyl-2-oxo-1,3,2
| Molecular Formula | C10H21Cl2N2O2P |
|---|---|
| Molecular Weight | 302.07 g/mol |
| LogP | 3.0511 |
| Topological Polar Surface Area | 41.57 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Exact Mass | 302.07178 |
| Heavy Atoms | 17 |
| Complexity | 296.0305 |
Chemical Identifiers
| CAS Number | 70772-72-4 |
|---|---|
| SMILES | CC1CC(NP(=O)(O1)N(CCCl)CCCl)(C)C |
Product Overview
B 617 (CAS 70772-72-4), with molecular formula C10H21Cl2N2O2P and molecular weight 302.07 g/mol. IUPAC: N,N-bis(2-chloroethyl)-4,4,6-trimethyl-2-oxo-1,3,2λ5-oxazaphosphinan-2-amine.
Chemical Property Profile of B 617
Property Insights of B 617
The XLogP value of 3.0511 indicates that B 617 is lipophilic (fat-soluble), which may influence its absorption, distribution, and formulation strategy. With a topological polar surface area (TPSA) of 41.57 Ų, B 617 exhibits relatively low polarity, potentially indicating favorable cell membrane permeability. Following Lipinski's Rule of Five, B 617 has 1 hydrogen bond donor(s) and 2 hydrogen bond acceptor(s), all within the drug-like range, suggesting favorable oral bioavailability potential.
Frequently Asked Questions
Frequently Asked Questions
What is the CAS number of B 617?
The CAS number of B 617 is 70772-72-4.
What is the molecular formula of B 617?
The molecular formula of B 617 is C10H21Cl2N2O2P.
What is the molecular weight of B 617?
The molecular weight of B 617 is 302.07 g/mol.
Where can I buy B 617?
You can request a quote for B 617 directly from KEHONG BIO. Contact us or email info@kehongbio.com for pricing and availability.
Does KEHONG BIO offer custom synthesis for B 617?
Yes, KEHONG BIO provides custom synthesis services for B 617 and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.