B 690
TL;DR: B 690 (CAS 70772-71-3) is a chemical compound with molecular formula C9H19Cl2N2O2P and molecular weight 288.06 g/mol, supplied by Kehong Biological (Henan Kehong Biological Technology Co., Ltd.) with CRO/CDMO custom synthesis services.
N,N-bis(2-chloroethyl)-4,5-dimethyl-2-oxo-1,3,2λ5-oxazaphosphinan-2-amine
Also Known As: B 690, B-490, Tetrahydro-2-(bis(2-chloroethyl)amino)-4,5-dimethyl-2H-1,3,2-oxazaphosphorine 2-oxide, 2H-1,3,2-Oxazaphosphorine, tetrahydro-2-(bis(2-chloroethyl)amino)-4,5-dimethyl-, 2-oxide, N,N-bis(2-chloroethyl)-4,5-dimethyl-2-oxo-1,3,2
| Molecular Formula | C9H19Cl2N2O2P |
|---|---|
| Molecular Weight | 288.06 g/mol |
| LogP | 2.5185 |
| Topological Polar Surface Area | 41.57 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Exact Mass | 288.05612 |
| Heavy Atoms | 16 |
| Complexity | 261.89355 |
Chemical Identifiers
| CAS Number | 70772-71-3 |
|---|---|
| SMILES | CC1COP(=O)(NC1C)N(CCCl)CCCl |
Product Overview
B 690 (CAS 70772-71-3), with molecular formula C9H19Cl2N2O2P and molecular weight 288.06 g/mol. IUPAC: N,N-bis(2-chloroethyl)-4,5-dimethyl-2-oxo-1,3,2λ5-oxazaphosphinan-2-amine.
Chemical Property Profile of B 690
Property Insights of B 690
The XLogP value of 2.5185 suggests moderate lipophilicity, balancing water solubility and membrane permeability for B 690. With a topological polar surface area (TPSA) of 41.57 Ų, B 690 exhibits relatively low polarity, potentially indicating favorable cell membrane permeability. Following Lipinski's Rule of Five, B 690 has 1 hydrogen bond donor(s) and 2 hydrogen bond acceptor(s), all within the drug-like range, suggesting favorable oral bioavailability potential.
Frequently Asked Questions
Frequently Asked Questions
What is the CAS number of B 690?
The CAS number of B 690 is 70772-71-3.
What is the molecular formula of B 690?
The molecular formula of B 690 is C9H19Cl2N2O2P.
What is the molecular weight of B 690?
The molecular weight of B 690 is 288.06 g/mol.
Where can I buy B 690?
You can request a quote for B 690 directly from KEHONG BIO. Contact us or email info@kehongbio.com for pricing and availability.
Does KEHONG BIO offer custom synthesis for B 690?
Yes, KEHONG BIO provides custom synthesis services for B 690 and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.