Strophanthidin + gulomethylose + glucose
TL;DR: Strophanthidin + gulomethylose + glucose (CAS 7044-33-9) is a chemical compound with molecular formula C35H52O15 and molecular weight 712.33 g/mol, supplied by Kehong Biological (Henan Kehong Biological Technology Co., Ltd.) with CRO/CDMO custom synthesis services.
(3S,5S,8R,9S,10S,13R,14S,17R)-3-[(2R,3R,4S,6R)-3,4-dihydroxy-6-methyl-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-5,14-dihydroxy-13-methyl-17-(5-oxo-2H-furan-3-yl)-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-10-carbaldehyde
Also Known As: Cheirotoxin, Bogoroside, Strophanthidin + gulomethylose + glucose, Strophanthidin + gulomethylose + glucose [German], (3S,5S,8R,9S,10S,13R,14S,17R)-3-((2R,3R,4S,6R)-3,4-dihydroxy-6-methyl-5-((2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl)oxyoxan-2-yl)oxy-5,14-dihydroxy-13-methyl-17-(5-oxo-2H-furan-3-yl)-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta(a)phenanthrene-10-carbaldehyde
| Molecular Formula | C35H52O15 |
|---|---|
| Molecular Weight | 712.33 g/mol |
| LogP | -2.3 |
| Topological Polar Surface Area | 242.0 Ų |
| Hydrogen Bond Donors | 8 |
| Hydrogen Bond Acceptors | 15 |
| Rotatable Bonds | 7 |
| Exact Mass | 712.3306 |
| Heavy Atoms | 50 |
| Complexity | 1340.0 |
Chemical Identifiers
| CAS Number | 7044-33-9 |
|---|---|
| SMILES | C[C@@H]1C([C@H]([C@H]([C@@H](O1)O[C@H]2CC[C@@]3([C@H]4CC[C@@]5([C@H](CC[C@@]5([C@@H]4CC[C@@]3(C2)O)O)C6=CC(=O)OC6)C)C=O)O)O)O[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)CO)O)O)O |
| InChIKey | CAYUJEAJKPLCAV-LPJFSPNFSA-N |
Product Overview
Strophanthidin + gulomethylose + glucose (CAS 7044-33-9), with molecular formula C35H52O15 and molecular weight 712.33 g/mol. IUPAC: (3S,5S,8R,9S,10S,13R,14S,17R)-3-[(2R,3R,4S,6R)-3,4-dihydroxy-6-methyl-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-5,14-dihydroxy-13-methyl-17-(5-oxo-2H-furan-3-yl)-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-10-carbaldehyde.
Chemical Property Profile of Strophanthidin + gulomethylose + glucose
Property Insights of Strophanthidin + gulomethylose + glucose
The XLogP value of -2.3 indicates that Strophanthidin + gulomethylose + glucose is hydrophilic (water-soluble), making it suitable for aqueous formulations and biological assay applications. The TPSA of 242.0 Ų indicates high polarity, suggesting Strophanthidin + gulomethylose + glucose may have limited membrane permeability but good aqueous solubility. Following Lipinski's Rule of Five, Strophanthidin + gulomethylose + glucose has 8 hydrogen bond donor(s) and 15 hydrogen bond acceptor(s), which may warrant consideration for formulation optimization.
Frequently Asked Questions
Frequently Asked Questions
What is the CAS number of Strophanthidin + gulomethylose + glucose?
The CAS number of Strophanthidin + gulomethylose + glucose is 7044-33-9.
What is the molecular formula of Strophanthidin + gulomethylose + glucose?
The molecular formula of Strophanthidin + gulomethylose + glucose is C35H52O15.
What is the molecular weight of Strophanthidin + gulomethylose + glucose?
The molecular weight of Strophanthidin + gulomethylose + glucose is 712.33 g/mol.
Where can I buy Strophanthidin + gulomethylose + glucose?
You can request a quote for Strophanthidin + gulomethylose + glucose directly from KEHONG BIO. Contact us or email info@kehongbio.com for pricing and availability.
Does KEHONG BIO offer custom synthesis for Strophanthidin + gulomethylose + glucose?
Yes, KEHONG BIO provides custom synthesis services for Strophanthidin + gulomethylose + glucose and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.