Pterosin B acetate
TL;DR: Pterosin B acetate (CAS 68373-72-8) is a chemical compound with molecular formula C16H20O3 and molecular weight 260.14 g/mol, supplied by Kehong Biological (Henan Kehong Biological Technology Co., Ltd.) with CRO/CDMO custom synthesis services.
2-[(2R)-2,4,6-trimethyl-3-oxo-1,2-dihydroinden-5-yl]ethyl acetate
Also Known As: Pterosin B acetate, 1H-Inden-1-one, 6-(2-(acetyloxy)ethyl)-2,3-dihydro-2,5,7-trimethy-, (R)-, (2r)-(2,4,6-trimethyl-3-oxo-2,3-dihydro-1h-inden-5-yl)ethyl acetate, 2-[(2R)-2,4,6-trimethyl-3-oxo-1,2-dihydroinden-5-yl]ethyl acetate, 2-[(2R)-2,4,6-Trimethyl-3-oxo-2,3-dihydro-1H-inden-5-yl]ethyl acetate
| Molecular Formula | C16H20O3 |
|---|---|
| Molecular Weight | 260.14 g/mol |
| LogP | 3.1 |
| Topological Polar Surface Area | 43.4 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Exact Mass | 260.14124 |
| Heavy Atoms | 19 |
| Complexity | 363.0 |
Chemical Identifiers
| CAS Number | 68373-72-8 |
|---|---|
| SMILES | C[C@@H]1CC2=C(C1=O)C(=C(C(=C2)C)CCOC(=O)C)C |
| InChIKey | BZJADYHLIUSORT-SNVBAGLBSA-N |
Product Overview
Pterosin B acetate (CAS 68373-72-8), with molecular formula C16H20O3 and molecular weight 260.14 g/mol. IUPAC: 2-[(2R)-2,4,6-trimethyl-3-oxo-1,2-dihydroinden-5-yl]ethyl acetate.
Chemical Property Profile of Pterosin B acetate
Property Insights of Pterosin B acetate
The XLogP value of 3.1 indicates that Pterosin B acetate is lipophilic (fat-soluble), which may influence its absorption, distribution, and formulation strategy. With a topological polar surface area (TPSA) of 43.4 Ų, Pterosin B acetate exhibits relatively low polarity, potentially indicating favorable cell membrane permeability. Following Lipinski's Rule of Five, Pterosin B acetate has 0 hydrogen bond donor(s) and 3 hydrogen bond acceptor(s), all within the drug-like range, suggesting favorable oral bioavailability potential.
Frequently Asked Questions
Frequently Asked Questions
What is the CAS number of Pterosin B acetate?
The CAS number of Pterosin B acetate is 68373-72-8.
What is the molecular formula of Pterosin B acetate?
The molecular formula of Pterosin B acetate is C16H20O3.
What is the molecular weight of Pterosin B acetate?
The molecular weight of Pterosin B acetate is 260.14 g/mol.
Where can I buy Pterosin B acetate?
You can request a quote for Pterosin B acetate directly from KEHONG BIO. Contact us or email info@kehongbio.com for pricing and availability.
Does KEHONG BIO offer custom synthesis for Pterosin B acetate?
Yes, KEHONG BIO provides custom synthesis services for Pterosin B acetate and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.