Deoxysappanone B 7,4'-dimethyl ether
TL;DR: Deoxysappanone B 7,4'-dimethyl ether (CAS 674786-37-9) is a chemical compound with molecular formula C18H18O5 and molecular weight 314.12 g/mol, supplied by Kehong Biological (Henan Kehong Biological Technology Co., Ltd.) with CRO/CDMO custom synthesis services.
3-[(3-hydroxy-4-methoxyphenyl)methyl]-7-methoxy-2,3-dihydrochromen-4-one
Also Known As: Dexysappanone, Deox B 7,4, Spectrum2_000197, Spectrum3_000185, Spectrum4_001504
| Molecular Formula | C18H18O5 |
|---|---|
| Molecular Weight | 314.12 g/mol |
| LogP | 2.8434 |
| Topological Polar Surface Area | 64.99 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Exact Mass | 314.11542 |
| Heavy Atoms | 23 |
| Complexity | 738.18695 |
Chemical Identifiers
| CAS Number | 674786-37-9 |
|---|---|
| SMILES | COC1=CC2=C(C=C1)C(=O)C(CO2)CC3=CC(=C(C=C3)OC)O |
Product Overview
Deoxysappanone B 7,4'-dimethyl ether (CAS 674786-37-9), with molecular formula C18H18O5 and molecular weight 314.12 g/mol. IUPAC: 3-[(3-hydroxy-4-methoxyphenyl)methyl]-7-methoxy-2,3-dihydrochromen-4-one.
Chemical Property Profile of Deoxysappanone B 7,4'-dimethyl ether
Property Insights of Deoxysappanone B 7,4'-dimethyl ether
The XLogP value of 2.8434 suggests moderate lipophilicity, balancing water solubility and membrane permeability for Deoxysappanone B 7,4'-dimethyl ether. The TPSA of 64.99 Ų falls within the moderate polarity range, balancing permeability and solubility for Deoxysappanone B 7,4'-dimethyl ether. Following Lipinski's Rule of Five, Deoxysappanone B 7,4'-dimethyl ether has 1 hydrogen bond donor(s) and 5 hydrogen bond acceptor(s), all within the drug-like range, suggesting favorable oral bioavailability potential.
Frequently Asked Questions
Frequently Asked Questions
What is the CAS number of Deoxysappanone B 7,4'-dimethyl ether?
The CAS number of Deoxysappanone B 7,4'-dimethyl ether is 674786-37-9.
What is the molecular formula of Deoxysappanone B 7,4'-dimethyl ether?
The molecular formula of Deoxysappanone B 7,4'-dimethyl ether is C18H18O5.
What is the molecular weight of Deoxysappanone B 7,4'-dimethyl ether?
The molecular weight of Deoxysappanone B 7,4'-dimethyl ether is 314.12 g/mol.
Where can I buy Deoxysappanone B 7,4'-dimethyl ether?
You can request a quote for Deoxysappanone B 7,4'-dimethyl ether directly from KEHONG BIO. Contact us or email info@kehongbio.com for pricing and availability.
Does KEHONG BIO offer custom synthesis for Deoxysappanone B 7,4'-dimethyl ether?
Yes, KEHONG BIO provides custom synthesis services for Deoxysappanone B 7,4'-dimethyl ether and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.