Vulgarone B
TL;DR: Vulgarone B (CAS 64834-00-0) is a chemical compound with molecular formula C15H22O and molecular weight 218.17 g/mol, supplied by Kehong Biological (Henan Kehong Biological Technology Co., Ltd.) with CRO/CDMO custom synthesis services.
2,6,6,11-tetramethyltricyclo[5.4.0.02,8]undec-10-en-9-one
Also Known As: Vulgarone B, Longiverbenone, Vulgarone, 1-Oxo-a-longipinene, A-longipin-2-en-1-one
| Molecular Formula | C15H22O |
|---|---|
| Molecular Weight | 218.17 g/mol |
| LogP | 3.6 |
| Topological Polar Surface Area | 17.1 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 1 |
| Rotatable Bonds | 0 |
| Exact Mass | 218.16707 |
| Heavy Atoms | 16 |
| Complexity | 390.0 |
Chemical Identifiers
| CAS Number | 64834-00-0 |
|---|---|
| SMILES | CC1=CC(=O)C2C3C1C2(CCCC3(C)C)C |
| InChIKey | KTPOZFYJWLGJGH-UHFFFAOYSA-N |
Product Overview
Vulgarone B (CAS 64834-00-0), with molecular formula C15H22O and molecular weight 218.17 g/mol. IUPAC: 2,6,6,11-tetramethyltricyclo[5.4.0.02,8]undec-10-en-9-one.
Chemical Property Profile of Vulgarone B
Property Insights of Vulgarone B
The XLogP value of 3.6 indicates that Vulgarone B is lipophilic (fat-soluble), which may influence its absorption, distribution, and formulation strategy. With a topological polar surface area (TPSA) of 17.1 Ų, Vulgarone B exhibits relatively low polarity, potentially indicating favorable cell membrane permeability. Following Lipinski's Rule of Five, Vulgarone B has 0 hydrogen bond donor(s) and 1 hydrogen bond acceptor(s), all within the drug-like range, suggesting favorable oral bioavailability potential.
Frequently Asked Questions
Frequently Asked Questions
What is the CAS number of Vulgarone B?
The CAS number of Vulgarone B is 64834-00-0.
What is the molecular formula of Vulgarone B?
The molecular formula of Vulgarone B is C15H22O.
What is the molecular weight of Vulgarone B?
The molecular weight of Vulgarone B is 218.17 g/mol.
Where can I buy Vulgarone B?
You can request a quote for Vulgarone B directly from KEHONG BIO. Contact us or email info@kehongbio.com for pricing and availability.
Does KEHONG BIO offer custom synthesis for Vulgarone B?
Yes, KEHONG BIO provides custom synthesis services for Vulgarone B and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.