Cepharadione B
TL;DR: Cepharadione B (CAS 6340-41-6) is a chemical compound with molecular formula C19H15NO4 and molecular weight 321.10 g/mol, supplied by Kehong Biological (Henan Kehong Biological Technology Co., Ltd.) with CRO/CDMO custom synthesis services.
15,16-dimethoxy-10-methyl-10-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,8,13,15-heptaene-11,12-dione
Also Known As: Cepharadione B, cepharadione-B, dimethoxy(methyl)[?]dione, 1,2-dimethoxy-6-methyl-4h-dibenzo[de,g]quinoline-4,5(6h)-dione, KST-1B6703
| Molecular Formula | C19H15NO4 |
|---|---|
| Molecular Weight | 321.10 g/mol |
| LogP | 3.3 |
| Topological Polar Surface Area | 55.8 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Exact Mass | 321.1001 |
| Heavy Atoms | 24 |
| Complexity | 535.0 |
Chemical Identifiers
| CAS Number | 6340-41-6 |
|---|---|
| SMILES | CN1C2=CC3=CC=CC=C3C4=C2C(=CC(=C4OC)OC)C(=O)C1=O |
| InChIKey | AFKGBLKLNRDQFN-UHFFFAOYSA-N |
Product Overview
Cepharadione B (CAS 6340-41-6), with molecular formula C19H15NO4 and molecular weight 321.10 g/mol. IUPAC: 15,16-dimethoxy-10-methyl-10-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,8,13,15-heptaene-11,12-dione.
Chemical Property Profile of Cepharadione B
Property Insights of Cepharadione B
The XLogP value of 3.3 indicates that Cepharadione B is lipophilic (fat-soluble), which may influence its absorption, distribution, and formulation strategy. With a topological polar surface area (TPSA) of 55.8 Ų, Cepharadione B exhibits relatively low polarity, potentially indicating favorable cell membrane permeability. Following Lipinski's Rule of Five, Cepharadione B has 0 hydrogen bond donor(s) and 4 hydrogen bond acceptor(s), all within the drug-like range, suggesting favorable oral bioavailability potential.
Frequently Asked Questions
Frequently Asked Questions
What is the CAS number of Cepharadione B?
The CAS number of Cepharadione B is 6340-41-6.
What is the molecular formula of Cepharadione B?
The molecular formula of Cepharadione B is C19H15NO4.
What is the molecular weight of Cepharadione B?
The molecular weight of Cepharadione B is 321.10 g/mol.
Where can I buy Cepharadione B?
You can request a quote for Cepharadione B directly from KEHONG BIO. Contact us or email info@kehongbio.com for pricing and availability.
Does KEHONG BIO offer custom synthesis for Cepharadione B?
Yes, KEHONG BIO provides custom synthesis services for Cepharadione B and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.