Plumbemycin B
TL;DR: Plumbemycin B (CAS 62896-17-7) is a chemical compound with molecular formula C12H21N4O8P and molecular weight 380.11 g/mol, supplied by Kehong Biological (Henan Kehong Biological Technology Co., Ltd.) with CRO/CDMO custom synthesis services.
2-[[4-amino-2-(2-aminopropanoylamino)-4-oxobutanoyl]amino]-5-phosphonopent-3-enoic acid
Also Known As: Plumbemycin B
| Molecular Formula | C12H21N4O8P |
|---|---|
| Molecular Weight | 380.11 g/mol |
| LogP | -6.7 |
| Topological Polar Surface Area | 222.0 Ų |
| Hydrogen Bond Donors | 7 |
| Hydrogen Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Exact Mass | 380.1097 |
| Heavy Atoms | 25 |
| Complexity | 602.0 |
Chemical Identifiers
| CAS Number | 62896-17-7 |
|---|---|
| SMILES | CC(C(=O)NC(CC(=O)N)C(=O)NC(C=CCP(=O)(O)O)C(=O)O)N |
| InChIKey | DDLKXVROBQHLLI-UHFFFAOYSA-N |
Product Overview
Plumbemycin B (CAS 62896-17-7), with molecular formula C12H21N4O8P and molecular weight 380.11 g/mol. IUPAC: 2-[[4-amino-2-(2-aminopropanoylamino)-4-oxobutanoyl]amino]-5-phosphonopent-3-enoic acid.
Chemical Property Profile of Plumbemycin B
Property Insights of Plumbemycin B
The XLogP value of -6.7 indicates that Plumbemycin B is hydrophilic (water-soluble), making it suitable for aqueous formulations and biological assay applications. The TPSA of 222.0 Ų indicates high polarity, suggesting Plumbemycin B may have limited membrane permeability but good aqueous solubility. Following Lipinski's Rule of Five, Plumbemycin B has 7 hydrogen bond donor(s) and 9 hydrogen bond acceptor(s), which may warrant consideration for formulation optimization.
Frequently Asked Questions
Frequently Asked Questions
What is the CAS number of Plumbemycin B?
The CAS number of Plumbemycin B is 62896-17-7.
What is the molecular formula of Plumbemycin B?
The molecular formula of Plumbemycin B is C12H21N4O8P.
What is the molecular weight of Plumbemycin B?
The molecular weight of Plumbemycin B is 380.11 g/mol.
Where can I buy Plumbemycin B?
You can request a quote for Plumbemycin B directly from KEHONG BIO. Contact us or email info@kehongbio.com for pricing and availability.
Does KEHONG BIO offer custom synthesis for Plumbemycin B?
Yes, KEHONG BIO provides custom synthesis services for Plumbemycin B and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.