PHYSALIN B 5,6-EPOXIDE
TL;DR: PHYSALIN B 5,6-EPOXIDE (CAS 57517-46-1) is a chemical compound with molecular formula C28H30O10 and molecular weight 526.18 g/mol, supplied by Kehong Biological (Henan Kehong Biological Technology Co., Ltd.) with CRO/CDMO custom synthesis services.
(2R,11R,12S,15S,18S,19R,20S,21S,23R,26S)-15-hydroxy-11,18,21-trimethyl-5,17,24,28,29-pentaoxanonacyclo[17.9.1.11,20.02,12.04,6.06,11.015,19.018,23.021,26]triacont-8-ene-10,16,25,30-tetrone
Also Known As: PHYSALIN B 5,6-EPOXIDE
| Molecular Formula | C28H30O10 |
|---|---|
| Molecular Weight | 526.18 g/mol |
| LogP | 0.7682 |
| Topological Polar Surface Area | 137.96 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 10 |
| Rotatable Bonds | 0 |
| Exact Mass | 526.1839 |
| Heavy Atoms | 38 |
| Complexity | 1340.3673 |
Chemical Identifiers
| CAS Number | 57517-46-1 |
|---|---|
| SMILES | C[C@]12C[C@@H]3[C@]4([C@]56[C@H]1C(=O)C(O5)([C@@H]7CC8C9(O8)CC=CC(=O)[C@@]9([C@H]7CC[C@]6(C(=O)O4)O)C)OC[C@H]2C(=O)O3)C |
Product Overview
PHYSALIN B 5,6-EPOXIDE (CAS 57517-46-1), with molecular formula C28H30O10 and molecular weight 526.18 g/mol. IUPAC: (2R,11R,12S,15S,18S,19R,20S,21S,23R,26S)-15-hydroxy-11,18,21-trimethyl-5,17,24,28,29-pentaoxanonacyclo[17.9.1.11,20.02,12.04,6.06,11.015,19.018,23.021,26]triacont-8-ene-10,16,25,30-tetrone.
Chemical Property Profile of PHYSALIN B 5,6-EPOXIDE
Property Insights of PHYSALIN B 5,6-EPOXIDE
The XLogP value of 0.7682 suggests moderate lipophilicity, balancing water solubility and membrane permeability for PHYSALIN B 5,6-EPOXIDE. The TPSA of 137.96 Ų falls within the moderate polarity range, balancing permeability and solubility for PHYSALIN B 5,6-EPOXIDE. Following Lipinski's Rule of Five, PHYSALIN B 5,6-EPOXIDE has 1 hydrogen bond donor(s) and 10 hydrogen bond acceptor(s), which may warrant consideration for formulation optimization.
Frequently Asked Questions
Frequently Asked Questions
What is the CAS number of PHYSALIN B 5,6-EPOXIDE?
The CAS number of PHYSALIN B 5,6-EPOXIDE is 57517-46-1.
What is the molecular formula of PHYSALIN B 5,6-EPOXIDE?
The molecular formula of PHYSALIN B 5,6-EPOXIDE is C28H30O10.
What is the molecular weight of PHYSALIN B 5,6-EPOXIDE?
The molecular weight of PHYSALIN B 5,6-EPOXIDE is 526.18 g/mol.
Where can I buy PHYSALIN B 5,6-EPOXIDE?
You can request a quote for PHYSALIN B 5,6-EPOXIDE directly from KEHONG BIO. Contact us or email info@kehongbio.com for pricing and availability.
Does KEHONG BIO offer custom synthesis for PHYSALIN B 5,6-EPOXIDE?
Yes, KEHONG BIO provides custom synthesis services for PHYSALIN B 5,6-EPOXIDE and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.