Rifamycin B methylpiperidinylamide
TL;DR: Rifamycin B methylpiperidinylamide (CAS 55372-20-8) is a chemical compound with molecular formula C45H61N3O13 and molecular weight 851.42 g/mol, supplied by Kehong Biological (Henan Kehong Biological Technology Co., Ltd.) with CRO/CDMO custom synthesis services.
[(9E,19E,21E)-2,15,17,29-tetrahydroxy-11-methoxy-3,7,12,14,16,18,22-heptamethyl-27-[2-[methyl(piperidin-1-yl)amino]-2-oxoethoxy]-6,23-dioxo-8,30-dioxa-24-azatetracyclo[23.3.1.14,7.05,28]triaconta-1(29),2,4,9,19,21,25,27-octaen-13-yl] acetate
Also Known As: Rifamycin B methylpiperidinylamide, Acetamide, 2-((1,2-dihydro-5,6,17,19,21-pentahydroxy-23-methoxy-2,4,12,16,18,20,22-heptamethyl-1,11-dioxo-2,7-(epoxypentadeca(1,11,13)trienimino)naphtho(2,1-b)furan-9-yl)oxy)-N-methyl-N-piperidino-, 21-acetate, Rifamycin, 4-O-[2-(methyl-1-piperidinylamino)-2-oxoethyl]-
| Molecular Formula | C45H61N3O13 |
|---|---|
| Molecular Weight | 851.42 g/mol |
| LogP | 5.28662 |
| Topological Polar Surface Area | 213.86 Ų |
| Hydrogen Bond Donors | 5 |
| Hydrogen Bond Acceptors | 14 |
| Rotatable Bonds | 6 |
| Exact Mass | 851.4204 |
| Heavy Atoms | 61 |
| Complexity | 2092.7043 |
Chemical Identifiers
| CAS Number | 55372-20-8 |
|---|---|
| SMILES | CC1/C=C/C=C(/C(=O)NC2=CC(=C3C(=C2O)C(=C(C4=C3C(=O)C(O4)(O/C=C/C(C(C(C(C(C(C1O)C)O)C)OC(=O)C)C)OC)C)C)O)OCC(=O)N(C)N5CCCCC5)\C |
Product Overview
Rifamycin B methylpiperidinylamide (CAS 55372-20-8), with molecular formula C45H61N3O13 and molecular weight 851.42 g/mol. IUPAC: [(9E,19E,21E)-2,15,17,29-tetrahydroxy-11-methoxy-3,7,12,14,16,18,22-heptamethyl-27-[2-[methyl(piperidin-1-yl)amino]-2-oxoethoxy]-6,23-dioxo-8,30-dioxa-24-azatetracyclo[23.3.1.14,7.05,28]triaconta-1(29),2,4,9,19,21,25,27-octaen-13-yl] acetate.
Chemical Property Profile of Rifamycin B methylpiperidinylamide
Property Insights of Rifamycin B methylpiperidinylamide
The XLogP value of 5.28662 indicates that Rifamycin B methylpiperidinylamide is lipophilic (fat-soluble), which may influence its absorption, distribution, and formulation strategy. The TPSA of 213.86 Ų indicates high polarity, suggesting Rifamycin B methylpiperidinylamide may have limited membrane permeability but good aqueous solubility. Following Lipinski's Rule of Five, Rifamycin B methylpiperidinylamide has 5 hydrogen bond donor(s) and 14 hydrogen bond acceptor(s), which may warrant consideration for formulation optimization.
Frequently Asked Questions
Frequently Asked Questions
What is the CAS number of Rifamycin B methylpiperidinylamide?
The CAS number of Rifamycin B methylpiperidinylamide is 55372-20-8.
What is the molecular formula of Rifamycin B methylpiperidinylamide?
The molecular formula of Rifamycin B methylpiperidinylamide is C45H61N3O13.
What is the molecular weight of Rifamycin B methylpiperidinylamide?
The molecular weight of Rifamycin B methylpiperidinylamide is 851.42 g/mol.
Where can I buy Rifamycin B methylpiperidinylamide?
You can request a quote for Rifamycin B methylpiperidinylamide directly from KEHONG BIO. Contact us or email info@kehongbio.com for pricing and availability.
Does KEHONG BIO offer custom synthesis for Rifamycin B methylpiperidinylamide?
Yes, KEHONG BIO provides custom synthesis services for Rifamycin B methylpiperidinylamide and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.