Rifamycin B dimethylmorpholide
TL;DR: Rifamycin B dimethylmorpholide (CAS 55372-15-1) is a chemical compound with molecular formula C45H60N2O14 and molecular weight 852.40 g/mol, supplied by Kehong Biological (Henan Kehong Biological Technology Co., Ltd.) with CRO/CDMO custom synthesis services.
[(9E,19E,21E)-27-[2-(3,5-dimethylmorpholin-4-yl)-2-oxoethoxy]-2,15,17,29-tetrahydroxy-11-methoxy-3,7,12,14,16,18,22-heptamethyl-6,23-dioxo-8,30-dioxa-24-azatetracyclo[23.3.1.14,7.05,28]triaconta-1(29),2,4,9,19,21,25,27-octaen-13-yl] acetate
Also Known As: Rifamycin B dimethylmorpholide, Morpholine, 4-(((1,2-dihydro-5,6,17,19,21-pentahydroxy-23-methoxy-2,4,12,16,18,20,22-heptamethyl-1,11-dioxo-2,7-(epoxypentadeca(1,11,13)trienimino)naphtho(2,1-b)furan-9-yl)oxy)acetyl)-3,5-dimethyl-, 21-acetate, Rifamycin, 4-O-[2-(3,5-dimethyl-4-morpholinyl)-2-oxoethyl]-
| Molecular Formula | C45H60N2O14 |
|---|---|
| Molecular Weight | 852.40 g/mol |
| LogP | 5.06312 |
| Topological Polar Surface Area | 219.85 Ų |
| Hydrogen Bond Donors | 5 |
| Hydrogen Bond Acceptors | 14 |
| Rotatable Bonds | 5 |
| Exact Mass | 852.4045 |
| Heavy Atoms | 61 |
| Complexity | 2103.5493 |
Chemical Identifiers
| CAS Number | 55372-15-1 |
|---|---|
| SMILES | CC1COCC(N1C(=O)COC2=C3C4=C(C(=C2)NC(=O)/C(=C/C=C/C(C(C(C(C(C(C(C(/C=C/OC5(C(=O)C3=C(O5)C(=C4O)C)C)OC)C)OC(=O)C)C)O)C)O)C)/C)O)C |
Product Overview
Rifamycin B dimethylmorpholide (CAS 55372-15-1), with molecular formula C45H60N2O14 and molecular weight 852.40 g/mol. IUPAC: [(9E,19E,21E)-27-[2-(3,5-dimethylmorpholin-4-yl)-2-oxoethoxy]-2,15,17,29-tetrahydroxy-11-methoxy-3,7,12,14,16,18,22-heptamethyl-6,23-dioxo-8,30-dioxa-24-azatetracyclo[23.3.1.14,7.05,28]triaconta-1(29),2,4,9,19,21,25,27-octaen-13-yl] acetate.
Chemical Property Profile of Rifamycin B dimethylmorpholide
Property Insights of Rifamycin B dimethylmorpholide
The XLogP value of 5.06312 indicates that Rifamycin B dimethylmorpholide is lipophilic (fat-soluble), which may influence its absorption, distribution, and formulation strategy. The TPSA of 219.85 Ų indicates high polarity, suggesting Rifamycin B dimethylmorpholide may have limited membrane permeability but good aqueous solubility. Following Lipinski's Rule of Five, Rifamycin B dimethylmorpholide has 5 hydrogen bond donor(s) and 14 hydrogen bond acceptor(s), which may warrant consideration for formulation optimization.
Frequently Asked Questions
Frequently Asked Questions
What is the CAS number of Rifamycin B dimethylmorpholide?
The CAS number of Rifamycin B dimethylmorpholide is 55372-15-1.
What is the molecular formula of Rifamycin B dimethylmorpholide?
The molecular formula of Rifamycin B dimethylmorpholide is C45H60N2O14.
What is the molecular weight of Rifamycin B dimethylmorpholide?
The molecular weight of Rifamycin B dimethylmorpholide is 852.40 g/mol.
Where can I buy Rifamycin B dimethylmorpholide?
You can request a quote for Rifamycin B dimethylmorpholide directly from KEHONG BIO. Contact us or email info@kehongbio.com for pricing and availability.
Does KEHONG BIO offer custom synthesis for Rifamycin B dimethylmorpholide?
Yes, KEHONG BIO provides custom synthesis services for Rifamycin B dimethylmorpholide and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.