Siastatin B
TL;DR: Siastatin B (CAS 54795-58-3) is a chemical compound with molecular formula C8H14N2O5 and molecular weight 218.09 g/mol, supplied by Kehong Biological (Henan Kehong Biological Technology Co., Ltd.) with CRO/CDMO custom synthesis services.
(3S,4S,5R,6R)-6-acetamido-4,5-dihydroxypiperidine-3-carboxylic acid
Also Known As: Siastatin B, Siastatin B microbial, starbld0005055, siastatin B of siastatin, (3S,4S,5R,6R)-6-acetamido-4,5-dihydroxypiperidine-3-carboxylic acid
| Molecular Formula | C8H14N2O5 |
|---|---|
| Molecular Weight | 218.09 g/mol |
| LogP | -2.5256 |
| Topological Polar Surface Area | 118.89 Ų |
| Hydrogen Bond Donors | 5 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Exact Mass | 218.09027 |
| Heavy Atoms | 15 |
| Complexity | 267.75763 |
Chemical Identifiers
| CAS Number | 54795-58-3 |
|---|---|
| SMILES | CC(=O)N[C@@H]1[C@H]([C@H]([C@H](CN1)C(=O)O)O)O |
Product Overview
Siastatin B (CAS 54795-58-3), with molecular formula C8H14N2O5 and molecular weight 218.09 g/mol. IUPAC: (3S,4S,5R,6R)-6-acetamido-4,5-dihydroxypiperidine-3-carboxylic acid.
Chemical Property Profile of Siastatin B
Property Insights of Siastatin B
The XLogP value of -2.5256 indicates that Siastatin B is hydrophilic (water-soluble), making it suitable for aqueous formulations and biological assay applications. The TPSA of 118.89 Ų falls within the moderate polarity range, balancing permeability and solubility for Siastatin B. Following Lipinski's Rule of Five, Siastatin B has 5 hydrogen bond donor(s) and 5 hydrogen bond acceptor(s), all within the drug-like range, suggesting favorable oral bioavailability potential.
Frequently Asked Questions
Frequently Asked Questions
What is the CAS number of Siastatin B?
The CAS number of Siastatin B is 54795-58-3.
What is the molecular formula of Siastatin B?
The molecular formula of Siastatin B is C8H14N2O5.
What is the molecular weight of Siastatin B?
The molecular weight of Siastatin B is 218.09 g/mol.
Where can I buy Siastatin B?
You can request a quote for Siastatin B directly from KEHONG BIO. Contact us or email info@kehongbio.com for pricing and availability.
Does KEHONG BIO offer custom synthesis for Siastatin B?
Yes, KEHONG BIO provides custom synthesis services for Siastatin B and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.