Fortimicin B
TL;DR: Fortimicin B (CAS 54783-95-8) is a chemical compound with molecular formula C15H32N4O5 and molecular weight 348.24 g/mol, supplied by Kehong Biological (Henan Kehong Biological Technology Co., Ltd.) with CRO/CDMO custom synthesis services.
2-amino-3-[3-amino-6-(1-aminoethyl)oxan-2-yl]oxy-6-methoxy-5-(methylamino)cyclohexane-1,4-diol
Also Known As: Fortimicin B, Astromicin B, 2-amino-3-[3-amino-6-(1-aminoethyl)oxan-2-yl]oxy-6-methoxy-5-(methylamino)cyclohexane-1,4-diol, 4-Amino-1,4-dideoxy-3-O-(2,6-diamino-2,3,4,6,7-pentadeoxy-beta-L-lyxo-heptopyranosyl)-6-O-methyl-1-(methylamino)-L-chiro-inositol
| Molecular Formula | C15H32N4O5 |
|---|---|
| Molecular Weight | 348.24 g/mol |
| LogP | -3.4 |
| Topological Polar Surface Area | 158.0 Ų |
| Hydrogen Bond Donors | 6 |
| Hydrogen Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Exact Mass | 348.23727 |
| Heavy Atoms | 24 |
| Complexity | 404.0 |
Chemical Identifiers
| CAS Number | 54783-95-8 |
|---|---|
| SMILES | CC(C1CCC(C(O1)OC2C(C(C(C(C2O)NC)OC)O)N)N)N |
| InChIKey | WFMQYKIRAVMXSU-UHFFFAOYSA-N |
Product Overview
Fortimicin B (CAS 54783-95-8), with molecular formula C15H32N4O5 and molecular weight 348.24 g/mol. IUPAC: 2-amino-3-[3-amino-6-(1-aminoethyl)oxan-2-yl]oxy-6-methoxy-5-(methylamino)cyclohexane-1,4-diol.
Chemical Property Profile of Fortimicin B
Property Insights of Fortimicin B
The XLogP value of -3.4 indicates that Fortimicin B is hydrophilic (water-soluble), making it suitable for aqueous formulations and biological assay applications. The TPSA of 158.0 Ų indicates high polarity, suggesting Fortimicin B may have limited membrane permeability but good aqueous solubility. Following Lipinski's Rule of Five, Fortimicin B has 6 hydrogen bond donor(s) and 9 hydrogen bond acceptor(s), which may warrant consideration for formulation optimization.
Frequently Asked Questions
Frequently Asked Questions
What is the CAS number of Fortimicin B?
The CAS number of Fortimicin B is 54783-95-8.
What is the molecular formula of Fortimicin B?
The molecular formula of Fortimicin B is C15H32N4O5.
What is the molecular weight of Fortimicin B?
The molecular weight of Fortimicin B is 348.24 g/mol.
Where can I buy Fortimicin B?
You can request a quote for Fortimicin B directly from KEHONG BIO. Contact us or email info@kehongbio.com for pricing and availability.
Does KEHONG BIO offer custom synthesis for Fortimicin B?
Yes, KEHONG BIO provides custom synthesis services for Fortimicin B and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.