Dihydrokikumycin B
TL;DR: Dihydrokikumycin B (CAS 5439-32-7) is a chemical compound with molecular formula C14H21N7O2 and molecular weight 319.18 g/mol, supplied by Kehong Biological (Henan Kehong Biological Technology Co., Ltd.) with CRO/CDMO custom synthesis services.
4-[[(2S)-5-amino-3,4-dihydro-2H-pyrrole-2-carbonyl]amino]-N-(3-amino-3-iminopropyl)-1-methylpyrrole-2-carboxamide
Also Known As: Dihydrokikumycin B, (S)-Dihydrokikumycin B, (4S)-(+)-Dihydrokikumycin B, (4R)-(-)-Dihydrokikumycin B, (4S)-(-)-Dihydrokikumycin B
| Molecular Formula | C14H21N7O2 |
|---|---|
| Molecular Weight | 319.18 g/mol |
| LogP | -2.5 |
| Topological Polar Surface Area | 151.0 Ų |
| Hydrogen Bond Donors | 5 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Exact Mass | 319.17566 |
| Heavy Atoms | 23 |
| Complexity | 519.0 |
Chemical Identifiers
| CAS Number | 5439-32-7 |
|---|---|
| SMILES | CN1C=C(C=C1C(=O)NCCC(=N)N)NC(=O)[C@@H]2CCC(=N2)N |
| InChIKey | JUMUOZAQBGYHOE-VIFPVBQESA-N |
Product Overview
Dihydrokikumycin B (CAS 5439-32-7), with molecular formula C14H21N7O2 and molecular weight 319.18 g/mol. IUPAC: 4-[[(2S)-5-amino-3,4-dihydro-2H-pyrrole-2-carbonyl]amino]-N-(3-amino-3-iminopropyl)-1-methylpyrrole-2-carboxamide.
Chemical Property Profile of Dihydrokikumycin B
Property Insights of Dihydrokikumycin B
The XLogP value of -2.5 indicates that Dihydrokikumycin B is hydrophilic (water-soluble), making it suitable for aqueous formulations and biological assay applications. The TPSA of 151.0 Ų indicates high polarity, suggesting Dihydrokikumycin B may have limited membrane permeability but good aqueous solubility. Following Lipinski's Rule of Five, Dihydrokikumycin B has 5 hydrogen bond donor(s) and 4 hydrogen bond acceptor(s), all within the drug-like range, suggesting favorable oral bioavailability potential.
Frequently Asked Questions
Frequently Asked Questions
What is the CAS number of Dihydrokikumycin B?
The CAS number of Dihydrokikumycin B is 5439-32-7.
What is the molecular formula of Dihydrokikumycin B?
The molecular formula of Dihydrokikumycin B is C14H21N7O2.
What is the molecular weight of Dihydrokikumycin B?
The molecular weight of Dihydrokikumycin B is 319.18 g/mol.
Where can I buy Dihydrokikumycin B?
You can request a quote for Dihydrokikumycin B directly from KEHONG BIO. Contact us or email info@kehongbio.com for pricing and availability.
Does KEHONG BIO offer custom synthesis for Dihydrokikumycin B?
Yes, KEHONG BIO provides custom synthesis services for Dihydrokikumycin B and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.