Everninomycin B
TL;DR: Everninomycin B (CAS 53296-30-3) is a chemical compound with molecular formula C66H99Cl2NO36 and molecular weight 1551.53 g/mol, supplied by Kehong Biological (Henan Kehong Biological Technology Co., Ltd.) with CRO/CDMO custom synthesis services.
[6-[4',7-dihydroxy-6-[3-hydroxy-2-[4-hydroxy-6-[7'-hydroxy-7-methoxy-7'-(1-methoxyethyl)spiro[4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-2,4'-6,7a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran]-6-yl]oxy-5-methoxy-2-(methoxymethyl)oxan-3-yl]oxy-5-methoxy-6-methyloxan-4-yl]oxy-2',4,7a-trimethylspiro[3a,4,6,7-tetrahydro-[1,3]dioxolo[4,5-c]pyran-2,6'-oxane]-3'-yl]oxy-4-(5-methoxy-4,6-dimethyl-4-nitrooxan-2-yl)oxy-2-methyloxan-3-yl] 3,5-dichloro-4-hydroxy-2-methoxy-6-methylbenzoate
Also Known As: Everninomycin-B, Everninomycin B, Everninomicin B, Eveninomicin B sodium salt, EVERNINOMICIN B SODIUM SALT
| Molecular Formula | C66H99Cl2NO36 |
|---|---|
| Molecular Weight | 1551.53 g/mol |
| LogP | -0.3 |
| Topological Polar Surface Area | 433.0 Ų |
| Hydrogen Bond Donors | 6 |
| Hydrogen Bond Acceptors | 36 |
| Rotatable Bonds | 22 |
| Exact Mass | 1551.5323 |
| Heavy Atoms | 105 |
| Complexity | 2930.0 |
Chemical Identifiers
| CAS Number | 53296-30-3 |
|---|---|
| SMILES | CC1C(C(CC(O1)OC2C(OC3(CC2O)OC4C(OC(C(C4(O3)C)O)OC5C(C(OC(C5OC)C)OC6C(OC(C(C6O)OC)OC7C(C8C(CO7)OC9(O8)C1C(C(CO9)(C(C)OC)O)OCO1)OC)COC)O)C)C)OC1CC(C(C(O1)C)OC)(C)[N+](=O)[O-])OC(=O)C1=C(C(=C(C(=C1OC)Cl)O)Cl)C |
| InChIKey | ZFRCWSCZDCAGAJ-UHFFFAOYSA-N |
Product Overview
Everninomycin B (CAS 53296-30-3), with molecular formula C66H99Cl2NO36 and molecular weight 1551.53 g/mol. IUPAC: [6-[4',7-dihydroxy-6-[3-hydroxy-2-[4-hydroxy-6-[7'-hydroxy-7-methoxy-7'-(1-methoxyethyl)spiro[4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-2,4'-6,7a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran]-6-yl]oxy-5-methoxy-2-(methoxymethyl)oxan-3-yl]oxy-5-methoxy-6-methyloxan-4-yl]oxy-2',4,7a-trimethylspiro[3a,4,6,7-tetrahydro-[1,3]dioxolo[4,5-c]pyran-2,6'-oxane]-3'-yl]oxy-4-(5-methoxy-4,6-dimethyl-4-nitrooxan-2-yl)oxy-2-methyloxan-3-yl] 3,5-dichloro-4-hydroxy-2-methoxy-6-methylbenzoate.
Chemical Property Profile of Everninomycin B
Property Insights of Everninomycin B
The XLogP value of -0.3 indicates that Everninomycin B is hydrophilic (water-soluble), making it suitable for aqueous formulations and biological assay applications. The TPSA of 433.0 Ų indicates high polarity, suggesting Everninomycin B may have limited membrane permeability but good aqueous solubility. Following Lipinski's Rule of Five, Everninomycin B has 6 hydrogen bond donor(s) and 36 hydrogen bond acceptor(s), which may warrant consideration for formulation optimization.
Frequently Asked Questions
Frequently Asked Questions
What is the CAS number of Everninomycin B?
The CAS number of Everninomycin B is 53296-30-3.
What is the molecular formula of Everninomycin B?
The molecular formula of Everninomycin B is C66H99Cl2NO36.
What is the molecular weight of Everninomycin B?
The molecular weight of Everninomycin B is 1551.53 g/mol.
Where can I buy Everninomycin B?
You can request a quote for Everninomycin B directly from KEHONG BIO. Contact us or email info@kehongbio.com for pricing and availability.
Does KEHONG BIO offer custom synthesis for Everninomycin B?
Yes, KEHONG BIO provides custom synthesis services for Everninomycin B and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.