Lactarorufin B
TL;DR: Lactarorufin B (CAS 52483-05-3) is a chemical compound with molecular formula C15H22O5 and molecular weight 282.15 g/mol, supplied by Kehong Biological (Henan Kehong Biological Technology Co., Ltd.) with CRO/CDMO custom synthesis services.
5,9-dihydroxy-7-(hydroxymethyl)-5,7-dimethyl-4,5a,6,8,8a,9-hexahydro-1H-azuleno[5,6-c]furan-3-one
Also Known As: Lactarorufin B, (+)-Lactarorufin B, Compound NP-018527, 5,9-dihydroxy-7-(hydroxymethyl)-5,7-dimethyl-4,5a,6,8,8a,9-hexahydro-1H-azuleno[5,6-c]furan-3-one
| Molecular Formula | C15H22O5 |
|---|---|
| Molecular Weight | 282.15 g/mol |
| LogP | -0.5 |
| Topological Polar Surface Area | 87.0 Ų |
| Hydrogen Bond Donors | 3 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Exact Mass | 282.14673 |
| Heavy Atoms | 20 |
| Complexity | 485.0 |
Chemical Identifiers
| CAS Number | 52483-05-3 |
|---|---|
| SMILES | CC1(CC2C(C1)C(CC3=C(C2O)COC3=O)(C)O)CO |
| InChIKey | DBKIEMOKQWYZOA-UHFFFAOYSA-N |
Product Overview
Lactarorufin B (CAS 52483-05-3), with molecular formula C15H22O5 and molecular weight 282.15 g/mol. IUPAC: 5,9-dihydroxy-7-(hydroxymethyl)-5,7-dimethyl-4,5a,6,8,8a,9-hexahydro-1H-azuleno[5,6-c]furan-3-one.
Chemical Property Profile of Lactarorufin B
Property Insights of Lactarorufin B
The XLogP value of -0.5 indicates that Lactarorufin B is hydrophilic (water-soluble), making it suitable for aqueous formulations and biological assay applications. The TPSA of 87.0 Ų falls within the moderate polarity range, balancing permeability and solubility for Lactarorufin B. Following Lipinski's Rule of Five, Lactarorufin B has 3 hydrogen bond donor(s) and 5 hydrogen bond acceptor(s), all within the drug-like range, suggesting favorable oral bioavailability potential.
Frequently Asked Questions
Frequently Asked Questions
What is the CAS number of Lactarorufin B?
The CAS number of Lactarorufin B is 52483-05-3.
What is the molecular formula of Lactarorufin B?
The molecular formula of Lactarorufin B is C15H22O5.
What is the molecular weight of Lactarorufin B?
The molecular weight of Lactarorufin B is 282.15 g/mol.
Where can I buy Lactarorufin B?
You can request a quote for Lactarorufin B directly from KEHONG BIO. Contact us or email info@kehongbio.com for pricing and availability.
Does KEHONG BIO offer custom synthesis for Lactarorufin B?
Yes, KEHONG BIO provides custom synthesis services for Lactarorufin B and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.