Carbamoyl Kanamycin B
TL;DR: Carbamoyl Kanamycin B (CAS 51736-76-6) is a chemical compound with molecular formula C19H38N6O11 and molecular weight 526.26 g/mol, supplied by Kehong Biological (Henan Kehong Biological Technology Co., Ltd.) with CRO/CDMO custom synthesis services.
[4-amino-6-[4,6-diamino-3-[3-amino-6-(aminomethyl)-4,5-dihydroxyoxan-2-yl]oxy-2-hydroxycyclohexyl]oxy-3,5-dihydroxyoxan-2-yl]methyl carbamate
Also Known As: Nebramycin IV, Nebramycin factor 4, Carbamoyl Kanamycin B, 6''-O-Carbamoylkanamycin B, D-Streptamine, O-3-amino-6-O-(aminocarbonyl)-3-deoxy-alpha-D-glucopyranosyl-(1-6)-O-(2,6-diamino-2,6-dideoxy-alpha-D-glucopyranosyl-(1-4))-2-deoxy-
| Molecular Formula | C19H38N6O11 |
|---|---|
| Molecular Weight | 526.26 g/mol |
| LogP | -7.222 |
| Topological Polar Surface Area | 320.49 Ų |
| Hydrogen Bond Donors | 11 |
| Hydrogen Bond Acceptors | 16 |
| Rotatable Bonds | 7 |
| Exact Mass | 526.2598 |
| Heavy Atoms | 36 |
| Complexity | 739.99506 |
Chemical Identifiers
| CAS Number | 51736-76-6 |
|---|---|
| SMILES | C1C(C(C(C(C1N)OC2C(C(C(C(O2)COC(=O)N)O)N)O)O)OC3C(C(C(C(O3)CN)O)O)N)N |
Product Overview
Carbamoyl Kanamycin B (CAS 51736-76-6), with molecular formula C19H38N6O11 and molecular weight 526.26 g/mol. IUPAC: [4-amino-6-[4,6-diamino-3-[3-amino-6-(aminomethyl)-4,5-dihydroxyoxan-2-yl]oxy-2-hydroxycyclohexyl]oxy-3,5-dihydroxyoxan-2-yl]methyl carbamate.
Chemical Property Profile of Carbamoyl Kanamycin B
Property Insights of Carbamoyl Kanamycin B
The XLogP value of -7.222 indicates that Carbamoyl Kanamycin B is hydrophilic (water-soluble), making it suitable for aqueous formulations and biological assay applications. The TPSA of 320.49 Ų indicates high polarity, suggesting Carbamoyl Kanamycin B may have limited membrane permeability but good aqueous solubility. Following Lipinski's Rule of Five, Carbamoyl Kanamycin B has 11 hydrogen bond donor(s) and 16 hydrogen bond acceptor(s), which may warrant consideration for formulation optimization.
Frequently Asked Questions
Frequently Asked Questions
What is the CAS number of Carbamoyl Kanamycin B?
The CAS number of Carbamoyl Kanamycin B is 51736-76-6.
What is the molecular formula of Carbamoyl Kanamycin B?
The molecular formula of Carbamoyl Kanamycin B is C19H38N6O11.
What is the molecular weight of Carbamoyl Kanamycin B?
The molecular weight of Carbamoyl Kanamycin B is 526.26 g/mol.
Where can I buy Carbamoyl Kanamycin B?
You can request a quote for Carbamoyl Kanamycin B directly from KEHONG BIO. Contact us or email info@kehongbio.com for pricing and availability.
Does KEHONG BIO offer custom synthesis for Carbamoyl Kanamycin B?
Yes, KEHONG BIO provides custom synthesis services for Carbamoyl Kanamycin B and related compounds. Contact us with your specific requirements including quantity, purity, and timeline.